1<?php 2///////////////////////////////////////////////////////////////// 3/// getID3() by James Heinrich <info@getid3.org> // 4// available at https://github.com/JamesHeinrich/getID3 // 5// or https://www.getid3.org // 6// or http://getid3.sourceforge.net // 7// // 8// /demo/demo.mp3header.php - part of getID3() // 9// Sample script for decoding MP3 header bytes // 10// see readme.txt for more details // 11// /// 12///////////////////////////////////////////////////////////////// 13 14if (!function_exists('PrintHexBytes')) { 15 function PrintHexBytes($string) { 16 $returnstring = ''; 17 for ($i = 0; $i < strlen($string); $i++) { 18 $returnstring .= str_pad(dechex(ord(substr($string, $i, 1))), 2, '0', STR_PAD_LEFT).' '; 19 } 20 return $returnstring; 21 } 22} 23 24if (!function_exists('PrintTextBytes')) { 25 function PrintTextBytes($string) { 26 $returnstring = ''; 27 for ($i = 0; $i < strlen($string); $i++) { 28 if (ord(substr($string, $i, 1)) <= 31) { 29 $returnstring .= ' '; 30 } else { 31 $returnstring .= ' '.substr($string, $i, 1).' '; 32 } 33 } 34 return $returnstring; 35 } 36} 37 38if (!function_exists('table_var_dump')) { 39 function table_var_dump($variable) { 40 $returnstring = ''; 41 switch (gettype($variable)) { 42 case 'array': 43 $returnstring .= '<table border="1" cellspacing="0" cellpadding="2">'; 44 foreach ($variable as $key => $value) { 45 $returnstring .= '<tr><td valign="top"><b>'.str_replace(chr(0), ' ', $key).'</b></td>'; 46 $returnstring .= '<td valign="top">'.gettype($value); 47 if (is_array($value)) { 48 $returnstring .= ' ('.count($value).')'; 49 } elseif (is_string($value)) { 50 $returnstring .= ' ('.strlen($value).')'; 51 } 52 if (($key == 'data') && isset($variable['image_mime']) && isset($variable['dataoffset'])) { 53 require_once(GETID3_INCLUDEPATH.'getid3.getimagesize.php'); 54 $imageinfo = array(); 55 if ($imagechunkcheck = GetDataImageSize($value, $imageinfo)) { 56 $DumpedImageSRC = (!empty($_REQUEST['filename']) ? $_REQUEST['filename'] : '.getid3').'.'.$variable['dataoffset'].'.'.image_type_to_mime_type($imagechunkcheck[2]); 57 if ($tempimagefile = fopen($DumpedImageSRC, 'wb')) { 58 fwrite($tempimagefile, $value); 59 fclose($tempimagefile); 60 } 61 $returnstring .= '</td><td><img src="'.$DumpedImageSRC.'" width="'.$imagechunkcheck[0].'" height="'.$imagechunkcheck[1].'"></td></tr>'; 62 } else { 63 $returnstring .= '</td><td><i>invalid image data</i></td></tr>'; 64 } 65 } else { 66 $returnstring .= '</td><td>'.table_var_dump($value).'</td></tr>'; 67 } 68 } 69 $returnstring .= '</table>'; 70 break; 71 72 case 'boolean': 73 $returnstring .= ($variable ? 'TRUE' : 'FALSE'); 74 break; 75 76 case 'integer': 77 case 'double': 78 case 'float': 79 $returnstring .= $variable; 80 break; 81 82 case 'object': 83 case 'null': 84 $returnstring .= string_var_dump($variable); 85 break; 86 87 case 'string': 88 $variable = str_replace(chr(0), ' ', $variable); 89 $varlen = strlen($variable); 90 for ($i = 0; $i < $varlen; $i++) { 91 if (preg_match('#['.chr(0x0A).chr(0x0D).' -;0-9A-Za-z]#', $variable[$i])) { 92 $returnstring .= $variable[$i]; 93 } else { 94 $returnstring .= '&#'.str_pad(ord($variable[$i]), 3, '0', STR_PAD_LEFT).';'; 95 } 96 } 97 $returnstring = nl2br($returnstring); 98 break; 99 100 default: 101 require_once(GETID3_INCLUDEPATH.'getid3.getimagesize.php'); 102 $imageinfo = array(); 103 if (($imagechunkcheck = GetDataImageSize(substr($variable, 0, 32768), $imageinfo)) && ($imagechunkcheck[2] >= 1) && ($imagechunkcheck[2] <= 3)) { 104 $returnstring .= '<table border="1" cellspacing="0" cellpadding="2">'; 105 $returnstring .= '<tr><td><b>type</b></td><td>'.image_type_to_mime_type($imagechunkcheck[2]).'</td></tr>'; 106 $returnstring .= '<tr><td><b>width</b></td><td>'.number_format($imagechunkcheck[0]).' px</td></tr>'; 107 $returnstring .= '<tr><td><b>height</b></td><td>'.number_format($imagechunkcheck[1]).' px</td></tr>'; 108 $returnstring .= '<tr><td><b>size</b></td><td>'.number_format(strlen($variable)).' bytes</td></tr></table>'; 109 } else { 110 $returnstring .= nl2br(htmlspecialchars(str_replace(chr(0), ' ', $variable))); 111 } 112 break; 113 } 114 return $returnstring; 115 } 116} 117 118if (!function_exists('string_var_dump')) { 119 function string_var_dump($variable) { 120 if (version_compare(PHP_VERSION, '4.3.0', '>=')) { 121 return print_r($variable, true); 122 } 123 ob_start(); 124 var_dump($variable); 125 $dumpedvariable = ob_get_contents(); 126 ob_end_clean(); 127 return $dumpedvariable; 128 } 129} 130 131if (!function_exists('fileextension')) { 132 function fileextension($filename, $numextensions=1) { 133 if (strstr($filename, '.')) { 134 $reversedfilename = strrev($filename); 135 $offset = 0; 136 for ($i = 0; $i < $numextensions; $i++) { 137 $offset = strpos($reversedfilename, '.', $offset + 1); 138 if ($offset === false) { 139 return ''; 140 } 141 } 142 return strrev(substr($reversedfilename, 0, $offset)); 143 } 144 return ''; 145 } 146} 147 148if (!function_exists('RemoveAccents')) { 149 function RemoveAccents($string) { 150 // return strtr($string, 'ŠŒŽšœžŸ¥µÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿ', 'SOZsozYYuAAAAAAACEEEEIIIIDNOOOOOOUUUUYsaaaaaaaceeeeiiiionoooooouuuuyy'); 151 // Revised version by marksteward@hotmail.com 152 return strtr(strtr($string, 'ŠŽšžŸÀÁÂÃÄÅÇÈÉÊËÌÍÎÏÑÒÓÔÕÖØÙÚÛÜÝàáâãäåçèéêëìíîïñòóôõöøùúûüýÿ', 'SZszYAAAAAACEEEEIIIINOOOOOOUUUUYaaaaaaceeeeiiiinoooooouuuuyy'), array('Þ' => 'TH', 'þ' => 'th', 'Ð' => 'DH', 'ð' => 'dh', 'ß' => 'ss', 'Œ' => 'OE', 'œ' => 'oe', 'Æ' => 'AE', 'æ' => 'ae', 'µ' => 'u')); 153 } 154} 155 156if (!function_exists('MoreNaturalSort')) { 157 function MoreNaturalSort($ar1, $ar2) { 158 if ($ar1 === $ar2) { 159 return 0; 160 } 161 $len1 = strlen($ar1); 162 $len2 = strlen($ar2); 163 $shortest = min($len1, $len2); 164 if (substr($ar1, 0, $shortest) === substr($ar2, 0, $shortest)) { 165 // the shorter argument is the beginning of the longer one, like "str" and "string" 166 if ($len1 < $len2) { 167 return -1; 168 } elseif ($len1 > $len2) { 169 return 1; 170 } 171 return 0; 172 } 173 $ar1 = RemoveAccents(strtolower(trim($ar1))); 174 $ar2 = RemoveAccents(strtolower(trim($ar2))); 175 $translatearray = array('\''=>'', '"'=>'', '_'=>' ', '('=>'', ')'=>'', '-'=>' ', ' '=>' ', '.'=>'', ','=>''); 176 foreach ($translatearray as $key => $val) { 177 $ar1 = str_replace($key, $val, $ar1); 178 $ar2 = str_replace($key, $val, $ar2); 179 } 180 181 if ($ar1 < $ar2) { 182 return -1; 183 } elseif ($ar1 > $ar2) { 184 return 1; 185 } 186 return 0; 187 } 188} 189 190if (!function_exists('trunc')) { 191 function trunc($floatnumber) { 192 // truncates a floating-point number at the decimal point 193 // returns int (if possible, otherwise float) 194 if ($floatnumber >= 1) { 195 $truncatednumber = floor($floatnumber); 196 } elseif ($floatnumber <= -1) { 197 $truncatednumber = ceil($floatnumber); 198 } else { 199 $truncatednumber = 0; 200 } 201 if ($truncatednumber <= pow(2, 30)) { 202 $truncatednumber = (int) $truncatednumber; 203 } 204 return $truncatednumber; 205 } 206} 207 208if (!function_exists('CastAsInt')) { 209 function CastAsInt($floatnum) { 210 // convert to float if not already 211 $floatnum = (float) $floatnum; 212 213 // convert a float to type int, only if possible 214 if (trunc($floatnum) == $floatnum) { 215 // it's not floating point 216 if ($floatnum <= pow(2, 30)) { 217 // it's within int range 218 $floatnum = (int) $floatnum; 219 } 220 } 221 return $floatnum; 222 } 223} 224 225if (!function_exists('getmicrotime')) { 226 function getmicrotime() { 227 list($usec, $sec) = explode(' ', microtime()); 228 return ((float) $usec + (float) $sec); 229 } 230} 231 232if (!function_exists('DecimalBinary2Float')) { 233 function DecimalBinary2Float($binarynumerator) { 234 $numerator = Bin2Dec($binarynumerator); 235 $denominator = Bin2Dec(str_repeat('1', strlen($binarynumerator))); 236 return ($numerator / $denominator); 237 } 238} 239 240if (!function_exists('NormalizeBinaryPoint')) { 241 function NormalizeBinaryPoint($binarypointnumber, $maxbits=52) { 242 // http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/binary.html 243 if (strpos($binarypointnumber, '.') === false) { 244 $binarypointnumber = '0.'.$binarypointnumber; 245 } elseif ($binarypointnumber[0] == '.') { 246 $binarypointnumber = '0'.$binarypointnumber; 247 } 248 $exponent = 0; 249 while (($binarypointnumber[0] != '1') || (substr($binarypointnumber, 1, 1) != '.')) { 250 if (substr($binarypointnumber, 1, 1) == '.') { 251 $exponent--; 252 $binarypointnumber = substr($binarypointnumber, 2, 1).'.'.substr($binarypointnumber, 3); 253 } else { 254 $pointpos = strpos($binarypointnumber, '.'); 255 $exponent += ($pointpos - 1); 256 $binarypointnumber = str_replace('.', '', $binarypointnumber); 257 $binarypointnumber = $binarypointnumber[0].'.'.substr($binarypointnumber, 1); 258 } 259 } 260 $binarypointnumber = str_pad(substr($binarypointnumber, 0, $maxbits + 2), $maxbits + 2, '0', STR_PAD_RIGHT); 261 return array('normalized'=>$binarypointnumber, 'exponent'=>(int) $exponent); 262 } 263} 264 265if (!function_exists('Float2BinaryDecimal')) { 266 function Float2BinaryDecimal($floatvalue) { 267 // http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/binary.html 268 $maxbits = 128; // to how many bits of precision should the calculations be taken? 269 $intpart = trunc($floatvalue); 270 $floatpart = abs($floatvalue - $intpart); 271 $pointbitstring = ''; 272 while (($floatpart != 0) && (strlen($pointbitstring) < $maxbits)) { 273 $floatpart *= 2; 274 $pointbitstring .= (string) trunc($floatpart); 275 $floatpart -= trunc($floatpart); 276 } 277 $binarypointnumber = decbin($intpart).'.'.$pointbitstring; 278 return $binarypointnumber; 279 } 280} 281 282if (!function_exists('Float2String')) { 283 function Float2String($floatvalue, $bits) { 284 // http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/ieee-expl.html 285 switch ($bits) { 286 case 32: 287 $exponentbits = 8; 288 $fractionbits = 23; 289 break; 290 291 case 64: 292 $exponentbits = 11; 293 $fractionbits = 52; 294 break; 295 296 default: 297 return false; 298 break; 299 } 300 if ($floatvalue >= 0) { 301 $signbit = '0'; 302 } else { 303 $signbit = '1'; 304 } 305 $normalizedbinary = NormalizeBinaryPoint(Float2BinaryDecimal($floatvalue), $fractionbits); 306 $biasedexponent = pow(2, $exponentbits - 1) - 1 + $normalizedbinary['exponent']; // (127 or 1023) +/- exponent 307 $exponentbitstring = str_pad(decbin($biasedexponent), $exponentbits, '0', STR_PAD_LEFT); 308 $fractionbitstring = str_pad(substr($normalizedbinary['normalized'], 2), $fractionbits, '0', STR_PAD_RIGHT); 309 310 return BigEndian2String(Bin2Dec($signbit.$exponentbitstring.$fractionbitstring), $bits % 8, false); 311 } 312} 313 314if (!function_exists('LittleEndian2Float')) { 315 function LittleEndian2Float($byteword) { 316 return BigEndian2Float(strrev($byteword)); 317 } 318} 319 320if (!function_exists('BigEndian2Float')) { 321 function BigEndian2Float($byteword) { 322 // ANSI/IEEE Standard 754-1985, Standard for Binary Floating Point Arithmetic 323 // http://www.psc.edu/general/software/packages/ieee/ieee.html 324 // http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/ieee.html 325 326 $bitword = BigEndian2Bin($byteword); 327 $signbit = $bitword[0]; 328 329 switch (strlen($byteword) * 8) { 330 case 32: 331 $exponentbits = 8; 332 $fractionbits = 23; 333 break; 334 335 case 64: 336 $exponentbits = 11; 337 $fractionbits = 52; 338 break; 339 340 case 80: 341 $exponentbits = 16; 342 $fractionbits = 64; 343 break; 344 345 default: 346 return false; 347 break; 348 } 349 $exponentstring = substr($bitword, 1, $exponentbits - 1); 350 $fractionstring = substr($bitword, $exponentbits, $fractionbits); 351 $exponent = Bin2Dec($exponentstring); 352 $fraction = Bin2Dec($fractionstring); 353 354 if (($exponentbits == 16) && ($fractionbits == 64)) { 355 // 80-bit 356 // As used in Apple AIFF for sample_rate 357 // A bit of a hack, but it works ;) 358 return pow(2, ($exponent - 16382)) * DecimalBinary2Float($fractionstring); 359 } 360 361 362 if (($exponent == (pow(2, $exponentbits) - 1)) && ($fraction != 0)) { 363 // Not a Number 364 $floatvalue = false; 365 } elseif (($exponent == (pow(2, $exponentbits) - 1)) && ($fraction == 0)) { 366 if ($signbit == '1') { 367 $floatvalue = '-infinity'; 368 } else { 369 $floatvalue = '+infinity'; 370 } 371 } elseif (($exponent == 0) && ($fraction == 0)) { 372 if ($signbit == '1') { 373 $floatvalue = -0; 374 } else { 375 $floatvalue = 0; 376 } 377 $floatvalue = ($signbit ? 0 : -0); 378 } elseif (($exponent == 0) && ($fraction != 0)) { 379 // These are 'unnormalized' values 380 $floatvalue = pow(2, (-1 * (pow(2, $exponentbits - 1) - 2))) * DecimalBinary2Float($fractionstring); 381 if ($signbit == '1') { 382 $floatvalue *= -1; 383 } 384 } elseif ($exponent != 0) { 385 $floatvalue = pow(2, ($exponent - (pow(2, $exponentbits - 1) - 1))) * (1 + DecimalBinary2Float($fractionstring)); 386 if ($signbit == '1') { 387 $floatvalue *= -1; 388 } 389 } 390 return (float) $floatvalue; 391 } 392} 393 394if (!function_exists('BigEndian2Int')) { 395 function BigEndian2Int($byteword, $synchsafe=false, $signed=false) { 396 $intvalue = 0; 397 $bytewordlen = strlen($byteword); 398 for ($i = 0; $i < $bytewordlen; $i++) { 399 if ($synchsafe) { // disregard MSB, effectively 7-bit bytes 400 $intvalue = $intvalue | (ord($byteword[$i]) & 0x7F) << (($bytewordlen - 1 - $i) * 7); 401 } else { 402 $intvalue += ord($byteword[$i]) * pow(256, ($bytewordlen - 1 - $i)); 403 } 404 } 405 if ($signed && !$synchsafe) { 406 // synchsafe ints are not allowed to be signed 407 switch ($bytewordlen) { 408 case 1: 409 case 2: 410 case 3: 411 case 4: 412 $signmaskbit = 0x80 << (8 * ($bytewordlen - 1)); 413 if ($intvalue & $signmaskbit) { 414 $intvalue = 0 - ($intvalue & ($signmaskbit - 1)); 415 } 416 break; 417 418 default: 419 die('ERROR: Cannot have signed integers larger than 32-bits in BigEndian2Int()'); 420 break; 421 } 422 } 423 return CastAsInt($intvalue); 424 } 425} 426 427if (!function_exists('LittleEndian2Int')) { 428 function LittleEndian2Int($byteword, $signed=false) { 429 return BigEndian2Int(strrev($byteword), false, $signed); 430 } 431} 432 433if (!function_exists('BigEndian2Bin')) { 434 function BigEndian2Bin($byteword) { 435 $binvalue = ''; 436 $bytewordlen = strlen($byteword); 437 for ($i = 0; $i < $bytewordlen; $i++) { 438 $binvalue .= str_pad(decbin(ord($byteword[$i])), 8, '0', STR_PAD_LEFT); 439 } 440 return $binvalue; 441 } 442} 443 444if (!function_exists('BigEndian2String')) { 445 function BigEndian2String($number, $minbytes=1, $synchsafe=false, $signed=false) { 446 if ($number < 0) { 447 return false; 448 } 449 $maskbyte = (($synchsafe || $signed) ? 0x7F : 0xFF); 450 $intstring = ''; 451 if ($signed) { 452 if ($minbytes > 4) { 453 die('ERROR: Cannot have signed integers larger than 32-bits in BigEndian2String()'); 454 } 455 $number = $number & (0x80 << (8 * ($minbytes - 1))); 456 } 457 while ($number != 0) { 458 $quotient = ($number / ($maskbyte + 1)); 459 $intstring = chr(ceil(($quotient - floor($quotient)) * $maskbyte)).$intstring; 460 $number = floor($quotient); 461 } 462 return str_pad($intstring, $minbytes, chr(0), STR_PAD_LEFT); 463 } 464} 465 466if (!function_exists('Dec2Bin')) { 467 function Dec2Bin($number) { 468 while ($number >= 256) { 469 $bytes[] = (($number / 256) - (floor($number / 256))) * 256; 470 $number = floor($number / 256); 471 } 472 $bytes[] = $number; 473 $binstring = ''; 474 for ($i = 0; $i < count($bytes); $i++) { 475 $binstring = (($i == count($bytes) - 1) ? decbin($bytes[$i]) : str_pad(decbin($bytes[$i]), 8, '0', STR_PAD_LEFT)).$binstring; 476 } 477 return $binstring; 478 } 479} 480 481if (!function_exists('Bin2Dec')) { 482 function Bin2Dec($binstring) { 483 $decvalue = 0; 484 for ($i = 0; $i < strlen($binstring); $i++) { 485 $decvalue += ((int) substr($binstring, strlen($binstring) - $i - 1, 1)) * pow(2, $i); 486 } 487 return CastAsInt($decvalue); 488 } 489} 490 491if (!function_exists('Bin2String')) { 492 function Bin2String($binstring) { 493 // return 'hi' for input of '0110100001101001' 494 $string = ''; 495 $binstringreversed = strrev($binstring); 496 for ($i = 0; $i < strlen($binstringreversed); $i += 8) { 497 $string = chr(Bin2Dec(strrev(substr($binstringreversed, $i, 8)))).$string; 498 } 499 return $string; 500 } 501} 502 503if (!function_exists('LittleEndian2String')) { 504 function LittleEndian2String($number, $minbytes=1, $synchsafe=false) { 505 $intstring = ''; 506 while ($number > 0) { 507 if ($synchsafe) { 508 $intstring = $intstring.chr($number & 127); 509 $number >>= 7; 510 } else { 511 $intstring = $intstring.chr($number & 255); 512 $number >>= 8; 513 } 514 } 515 return str_pad($intstring, $minbytes, chr(0), STR_PAD_RIGHT); 516 } 517} 518 519if (!function_exists('Bool2IntString')) { 520 function Bool2IntString($intvalue) { 521 return ($intvalue ? '1' : '0'); 522 } 523} 524 525if (!function_exists('IntString2Bool')) { 526 function IntString2Bool($char) { 527 if ($char == '1') { 528 return true; 529 } elseif ($char == '0') { 530 return false; 531 } 532 return null; 533 } 534} 535 536if (!function_exists('InverseBoolean')) { 537 function InverseBoolean($value) { 538 return ($value ? false : true); 539 } 540} 541 542if (!function_exists('DeUnSynchronise')) { 543 function DeUnSynchronise($data) { 544 return str_replace(chr(0xFF).chr(0x00), chr(0xFF), $data); 545 } 546} 547 548if (!function_exists('Unsynchronise')) { 549 function Unsynchronise($data) { 550 // Whenever a false synchronisation is found within the tag, one zeroed 551 // byte is inserted after the first false synchronisation byte. The 552 // format of a correct sync that should be altered by ID3 encoders is as 553 // follows: 554 // %11111111 111xxxxx 555 // And should be replaced with: 556 // %11111111 00000000 111xxxxx 557 // This has the side effect that all $FF 00 combinations have to be 558 // altered, so they won't be affected by the decoding process. Therefore 559 // all the $FF 00 combinations have to be replaced with the $FF 00 00 560 // combination during the unsynchronisation. 561 562 $data = str_replace(chr(0xFF).chr(0x00), chr(0xFF).chr(0x00).chr(0x00), $data); 563 $unsyncheddata = ''; 564 for ($i = 0; $i < strlen($data); $i++) { 565 $thischar = $data[$i]; 566 $unsyncheddata .= $thischar; 567 if ($thischar == chr(255)) { 568 $nextchar = ord(substr($data, $i + 1, 1)); 569 if (($nextchar | 0xE0) == 0xE0) { 570 // previous byte = 11111111, this byte = 111????? 571 $unsyncheddata .= chr(0); 572 } 573 } 574 } 575 return $unsyncheddata; 576 } 577} 578 579if (!function_exists('is_hash')) { 580 function is_hash($var) { 581 // written by dev-null@christophe.vg 582 // taken from http://www.php.net/manual/en/function.array-merge-recursive.php 583 if (is_array($var)) { 584 $keys = array_keys($var); 585 $all_num = true; 586 for ($i = 0; $i < count($keys); $i++) { 587 if (is_string($keys[$i])) { 588 return true; 589 } 590 } 591 } 592 return false; 593 } 594} 595 596if (!function_exists('array_join_merge')) { 597 function array_join_merge($arr1, $arr2) { 598 // written by dev-null@christophe.vg 599 // taken from http://www.php.net/manual/en/function.array-merge-recursive.php 600 if (is_array($arr1) && is_array($arr2)) { 601 // the same -> merge 602 $new_array = array(); 603 604 if (is_hash($arr1) && is_hash($arr2)) { 605 // hashes -> merge based on keys 606 $keys = array_merge(array_keys($arr1), array_keys($arr2)); 607 foreach ($keys as $key) { 608 $arr1[$key] = (isset($arr1[$key]) ? $arr1[$key] : ''); 609 $arr2[$key] = (isset($arr2[$key]) ? $arr2[$key] : ''); 610 $new_array[$key] = array_join_merge($arr1[$key], $arr2[$key]); 611 } 612 } else { 613 // two real arrays -> merge 614 $new_array = array_reverse(array_unique(array_reverse(array_merge($arr1,$arr2)))); 615 } 616 return $new_array; 617 } else { 618 // not the same ... take new one if defined, else the old one stays 619 return $arr2 ? $arr2 : $arr1; 620 } 621 } 622} 623 624if (!function_exists('array_merge_clobber')) { 625 function array_merge_clobber($array1, $array2) { 626 // written by kc@hireability.com 627 // taken from http://www.php.net/manual/en/function.array-merge-recursive.php 628 if (!is_array($array1) || !is_array($array2)) { 629 return false; 630 } 631 $newarray = $array1; 632 foreach ($array2 as $key => $val) { 633 if (is_array($val) && isset($newarray[$key]) && is_array($newarray[$key])) { 634 $newarray[$key] = array_merge_clobber($newarray[$key], $val); 635 } else { 636 $newarray[$key] = $val; 637 } 638 } 639 return $newarray; 640 } 641} 642 643if (!function_exists('array_merge_noclobber')) { 644 function array_merge_noclobber($array1, $array2) { 645 if (!is_array($array1) || !is_array($array2)) { 646 return false; 647 } 648 $newarray = $array1; 649 foreach ($array2 as $key => $val) { 650 if (is_array($val) && isset($newarray[$key]) && is_array($newarray[$key])) { 651 $newarray[$key] = array_merge_noclobber($newarray[$key], $val); 652 } elseif (!isset($newarray[$key])) { 653 $newarray[$key] = $val; 654 } 655 } 656 return $newarray; 657 } 658} 659 660if (!function_exists('RoughTranslateUnicodeToASCII')) { 661 function RoughTranslateUnicodeToASCII($rawdata, $frame_textencoding) { 662 // rough translation of data for application that can't handle Unicode data 663 664 $tempstring = ''; 665 switch ($frame_textencoding) { 666 case 0: // ISO-8859-1. Terminated with $00. 667 $asciidata = $rawdata; 668 break; 669 670 case 1: // UTF-16 encoded Unicode with BOM. Terminated with $00 00. 671 $asciidata = $rawdata; 672 if (substr($asciidata, 0, 2) == chr(0xFF).chr(0xFE)) { 673 // remove BOM, only if present (it should be, but...) 674 $asciidata = substr($asciidata, 2); 675 } 676 if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) { 677 $asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...) 678 } 679 for ($i = 0; $i < strlen($asciidata); $i += 2) { 680 if ((ord($asciidata[$i]) <= 0x7F) || (ord($asciidata[$i]) >= 0xA0)) { 681 $tempstring .= $asciidata[$i]; 682 } else { 683 $tempstring .= '?'; 684 } 685 } 686 $asciidata = $tempstring; 687 break; 688 689 case 2: // UTF-16BE encoded Unicode without BOM. Terminated with $00 00. 690 $asciidata = $rawdata; 691 if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) { 692 $asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...) 693 } 694 for ($i = 0; $i < strlen($asciidata); $i += 2) { 695 if ((ord($asciidata[$i]) <= 0x7F) || (ord($asciidata[$i]) >= 0xA0)) { 696 $tempstring .= $asciidata[$i]; 697 } else { 698 $tempstring .= '?'; 699 } 700 } 701 $asciidata = $tempstring; 702 break; 703 704 case 3: // UTF-8 encoded Unicode. Terminated with $00. 705 $asciidata = utf8_decode($rawdata); 706 break; 707 708 case 255: // Unicode, Big-Endian. Terminated with $00 00. 709 $asciidata = $rawdata; 710 if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) { 711 $asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...) 712 } 713 for ($i = 0; ($i + 1) < strlen($asciidata); $i += 2) { 714 if ((ord($asciidata[($i + 1)]) <= 0x7F) || (ord($asciidata[($i + 1)]) >= 0xA0)) { 715 $tempstring .= $asciidata[($i + 1)]; 716 } else { 717 $tempstring .= '?'; 718 } 719 } 720 $asciidata = $tempstring; 721 break; 722 723 724 default: 725 // shouldn't happen, but in case $frame_textencoding is not 1 <= $frame_textencoding <= 4 726 // just pass the data through unchanged. 727 $asciidata = $rawdata; 728 break; 729 } 730 if (substr($asciidata, strlen($asciidata) - 1, 1) == chr(0)) { 731 // remove null terminator, if present 732 $asciidata = NoNullString($asciidata); 733 } 734 return $asciidata; 735 // return str_replace(chr(0), '', $asciidata); // just in case any nulls slipped through 736 } 737} 738 739if (!function_exists('PlaytimeString')) { 740 function PlaytimeString($playtimeseconds) { 741 $contentseconds = round((($playtimeseconds / 60) - floor($playtimeseconds / 60)) * 60); 742 $contentminutes = floor($playtimeseconds / 60); 743 if ($contentseconds >= 60) { 744 $contentseconds -= 60; 745 $contentminutes++; 746 } 747 return number_format($contentminutes).':'.str_pad($contentseconds, 2, 0, STR_PAD_LEFT); 748 } 749} 750 751if (!function_exists('CloseMatch')) { 752 function CloseMatch($value1, $value2, $tolerance) { 753 return (abs($value1 - $value2) <= $tolerance); 754 } 755} 756 757if (!function_exists('ID3v1matchesID3v2')) { 758 function ID3v1matchesID3v2($id3v1, $id3v2) { 759 760 $requiredindices = array('title', 'artist', 'album', 'year', 'genre', 'comment'); 761 foreach ($requiredindices as $requiredindex) { 762 if (!isset($id3v1["$requiredindex"])) { 763 $id3v1["$requiredindex"] = ''; 764 } 765 if (!isset($id3v2["$requiredindex"])) { 766 $id3v2["$requiredindex"] = ''; 767 } 768 } 769 770 if (trim($id3v1['title']) != trim(substr($id3v2['title'], 0, 30))) { 771 return false; 772 } 773 if (trim($id3v1['artist']) != trim(substr($id3v2['artist'], 0, 30))) { 774 return false; 775 } 776 if (trim($id3v1['album']) != trim(substr($id3v2['album'], 0, 30))) { 777 return false; 778 } 779 if (trim($id3v1['year']) != trim(substr($id3v2['year'], 0, 4))) { 780 return false; 781 } 782 if (trim($id3v1['genre']) != trim($id3v2['genre'])) { 783 return false; 784 } 785 if (isset($id3v1['track_number'])) { 786 if (!isset($id3v1['track_number']) || (trim($id3v1['track_number']) != trim($id3v2['track_number']))) { 787 return false; 788 } 789 if (trim($id3v1['comment']) != trim(substr($id3v2['comment'], 0, 28))) { 790 return false; 791 } 792 } else { 793 if (trim($id3v1['comment']) != trim(substr($id3v2['comment'], 0, 30))) { 794 return false; 795 } 796 } 797 return true; 798 } 799} 800 801if (!function_exists('FILETIMEtoUNIXtime')) { 802 function FILETIMEtoUNIXtime($FILETIME, $round=true) { 803 // FILETIME is a 64-bit unsigned integer representing 804 // the number of 100-nanosecond intervals since January 1, 1601 805 // UNIX timestamp is number of seconds since January 1, 1970 806 // 116444736000000000 = 10000000 * 60 * 60 * 24 * 365 * 369 + 89 leap days 807 if ($round) { 808 return round(($FILETIME - 116444736000000000) / 10000000); 809 } 810 return ($FILETIME - 116444736000000000) / 10000000; 811 } 812} 813 814if (!function_exists('GUIDtoBytestring')) { 815 function GUIDtoBytestring($GUIDstring) { 816 // Microsoft defines these 16-byte (128-bit) GUIDs in the strangest way: 817 // first 4 bytes are in little-endian order 818 // next 2 bytes are appended in little-endian order 819 // next 2 bytes are appended in little-endian order 820 // next 2 bytes are appended in big-endian order 821 // next 6 bytes are appended in big-endian order 822 823 // AaBbCcDd-EeFf-GgHh-IiJj-KkLlMmNnOoPp is stored as this 16-byte string: 824 // $Dd $Cc $Bb $Aa $Ff $Ee $Hh $Gg $Ii $Jj $Kk $Ll $Mm $Nn $Oo $Pp 825 826 $hexbytecharstring = chr(hexdec(substr($GUIDstring, 6, 2))); 827 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 4, 2))); 828 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 2, 2))); 829 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 0, 2))); 830 831 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 11, 2))); 832 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 9, 2))); 833 834 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 16, 2))); 835 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 14, 2))); 836 837 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 19, 2))); 838 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 21, 2))); 839 840 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 24, 2))); 841 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 26, 2))); 842 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 28, 2))); 843 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 30, 2))); 844 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 32, 2))); 845 $hexbytecharstring .= chr(hexdec(substr($GUIDstring, 34, 2))); 846 847 return $hexbytecharstring; 848 } 849} 850 851if (!function_exists('BytestringToGUID')) { 852 function BytestringToGUID($Bytestring) { 853 $GUIDstring = str_pad(dechex(ord($Bytestring[3])), 2, '0', STR_PAD_LEFT); 854 $GUIDstring .= str_pad(dechex(ord($Bytestring[2])), 2, '0', STR_PAD_LEFT); 855 $GUIDstring .= str_pad(dechex(ord($Bytestring[1])), 2, '0', STR_PAD_LEFT); 856 $GUIDstring .= str_pad(dechex(ord($Bytestring[0])), 2, '0', STR_PAD_LEFT); 857 $GUIDstring .= '-'; 858 $GUIDstring .= str_pad(dechex(ord($Bytestring[5])), 2, '0', STR_PAD_LEFT); 859 $GUIDstring .= str_pad(dechex(ord($Bytestring[4])), 2, '0', STR_PAD_LEFT); 860 $GUIDstring .= '-'; 861 $GUIDstring .= str_pad(dechex(ord($Bytestring[7])), 2, '0', STR_PAD_LEFT); 862 $GUIDstring .= str_pad(dechex(ord($Bytestring[6])), 2, '0', STR_PAD_LEFT); 863 $GUIDstring .= '-'; 864 $GUIDstring .= str_pad(dechex(ord($Bytestring[8])), 2, '0', STR_PAD_LEFT); 865 $GUIDstring .= str_pad(dechex(ord($Bytestring[9])), 2, '0', STR_PAD_LEFT); 866 $GUIDstring .= '-'; 867 $GUIDstring .= str_pad(dechex(ord($Bytestring[10])), 2, '0', STR_PAD_LEFT); 868 $GUIDstring .= str_pad(dechex(ord($Bytestring[11])), 2, '0', STR_PAD_LEFT); 869 $GUIDstring .= str_pad(dechex(ord($Bytestring[12])), 2, '0', STR_PAD_LEFT); 870 $GUIDstring .= str_pad(dechex(ord($Bytestring[13])), 2, '0', STR_PAD_LEFT); 871 $GUIDstring .= str_pad(dechex(ord($Bytestring[14])), 2, '0', STR_PAD_LEFT); 872 $GUIDstring .= str_pad(dechex(ord($Bytestring[15])), 2, '0', STR_PAD_LEFT); 873 874 return strtoupper($GUIDstring); 875 } 876} 877 878if (!function_exists('BitrateColor')) { 879 function BitrateColor($bitrate) { 880 $bitrate /= 3; // scale from 1-768kbps to 1-256kbps 881 $bitrate--; // scale from 1-256kbps to 0-255kbps 882 $bitrate = max($bitrate, 0); 883 $bitrate = min($bitrate, 255); 884 //$bitrate = max($bitrate, 32); 885 //$bitrate = min($bitrate, 143); 886 //$bitrate = ($bitrate * 2) - 32; 887 888 $Rcomponent = max(255 - ($bitrate * 2), 0); 889 $Gcomponent = max(($bitrate * 2) - 255, 0); 890 if ($bitrate > 127) { 891 $Bcomponent = max((255 - $bitrate) * 2, 0); 892 } else { 893 $Bcomponent = max($bitrate * 2, 0); 894 } 895 return str_pad(dechex($Rcomponent), 2, '0', STR_PAD_LEFT).str_pad(dechex($Gcomponent), 2, '0', STR_PAD_LEFT).str_pad(dechex($Bcomponent), 2, '0', STR_PAD_LEFT); 896 } 897} 898 899if (!function_exists('BitrateText')) { 900 function BitrateText($bitrate) { 901 return '<SPAN STYLE="color: #'.BitrateColor($bitrate).'">'.round($bitrate).' kbps</SPAN>'; 902 } 903} 904 905if (!function_exists('image_type_to_mime_type')) { 906 function image_type_to_mime_type($imagetypeid) { 907 // only available in PHP v4.3.0+ 908 static $image_type_to_mime_type = array(); 909 if (empty($image_type_to_mime_type)) { 910 $image_type_to_mime_type[1] = 'image/gif'; // GIF 911 $image_type_to_mime_type[2] = 'image/jpeg'; // JPEG 912 $image_type_to_mime_type[3] = 'image/png'; // PNG 913 $image_type_to_mime_type[4] = 'application/x-shockwave-flash'; // Flash 914 $image_type_to_mime_type[5] = 'image/psd'; // PSD 915 $image_type_to_mime_type[6] = 'image/bmp'; // BMP 916 $image_type_to_mime_type[7] = 'image/tiff'; // TIFF: little-endian (Intel) 917 $image_type_to_mime_type[8] = 'image/tiff'; // TIFF: big-endian (Motorola) 918 //$image_type_to_mime_type[9] = 'image/jpc'; // JPC 919 //$image_type_to_mime_type[10] = 'image/jp2'; // JPC 920 //$image_type_to_mime_type[11] = 'image/jpx'; // JPC 921 //$image_type_to_mime_type[12] = 'image/jb2'; // JPC 922 $image_type_to_mime_type[13] = 'application/x-shockwave-flash'; // Shockwave 923 $image_type_to_mime_type[14] = 'image/iff'; // IFF 924 } 925 return (isset($image_type_to_mime_type[$imagetypeid]) ? $image_type_to_mime_type[$imagetypeid] : 'application/octet-stream'); 926 } 927} 928 929if (!function_exists('utf8_decode')) { 930 // PHP has this function built-in if it's configured with the --with-xml option 931 // This version of the function is only provided in case XML isn't installed 932 function utf8_decode($utf8text) { 933 // http://www.php.net/manual/en/function.utf8-encode.php 934 // bytes bits representation 935 // 1 7 0bbbbbbb 936 // 2 11 110bbbbb 10bbbbbb 937 // 3 16 1110bbbb 10bbbbbb 10bbbbbb 938 // 4 21 11110bbb 10bbbbbb 10bbbbbb 10bbbbbb 939 940 $utf8length = strlen($utf8text); 941 $decodedtext = ''; 942 for ($i = 0; $i < $utf8length; $i++) { 943 if ((ord($utf8text[$i]) & 0x80) == 0) { 944 $decodedtext .= $utf8text[$i]; 945 } elseif ((ord($utf8text[$i]) & 0xF0) == 0xF0) { 946 $decodedtext .= '?'; 947 $i += 3; 948 } elseif ((ord($utf8text[$i]) & 0xE0) == 0xE0) { 949 $decodedtext .= '?'; 950 $i += 2; 951 } elseif ((ord($utf8text[$i]) & 0xC0) == 0xC0) { 952 // 2 11 110bbbbb 10bbbbbb 953 $decodedchar = Bin2Dec(substr(Dec2Bin(ord($utf8text[$i])), 3, 5).substr(Dec2Bin(ord($utf8text[($i + 1)])), 2, 6)); 954 if ($decodedchar <= 255) { 955 $decodedtext .= chr($decodedchar); 956 } else { 957 $decodedtext .= '?'; 958 } 959 $i += 1; 960 } 961 } 962 return $decodedtext; 963 } 964} 965 966if (!function_exists('DateMac2Unix')) { 967 function DateMac2Unix($macdate) { 968 // Macintosh timestamp: seconds since 00:00h January 1, 1904 969 // UNIX timestamp: seconds since 00:00h January 1, 1970 970 return CastAsInt($macdate - 2082844800); 971 } 972} 973 974 975if (!function_exists('FixedPoint8_8')) { 976 function FixedPoint8_8($rawdata) { 977 return BigEndian2Int(substr($rawdata, 0, 1)) + (float) (BigEndian2Int(substr($rawdata, 1, 1)) / pow(2, 8)); 978 } 979} 980 981 982if (!function_exists('FixedPoint16_16')) { 983 function FixedPoint16_16($rawdata) { 984 return BigEndian2Int(substr($rawdata, 0, 2)) + (float) (BigEndian2Int(substr($rawdata, 2, 2)) / pow(2, 16)); 985 } 986} 987 988 989if (!function_exists('FixedPoint2_30')) { 990 function FixedPoint2_30($rawdata) { 991 $binarystring = BigEndian2Bin($rawdata); 992 return Bin2Dec(substr($binarystring, 0, 2)) + (float) (Bin2Dec(substr($binarystring, 2, 30)) / pow(2, 30)); 993 } 994} 995 996 997if (!function_exists('Pascal2String')) { 998 function Pascal2String($pascalstring) { 999 // Pascal strings have 1 byte at the beginning saying how many chars are in the string 1000 return substr($pascalstring, 1); 1001 } 1002} 1003 1004if (!function_exists('NoNullString')) { 1005 function NoNullString($nullterminatedstring) { 1006 // remove the single null terminator on null terminated strings 1007 if (substr($nullterminatedstring, strlen($nullterminatedstring) - 1, 1) === chr(0)) { 1008 return substr($nullterminatedstring, 0, strlen($nullterminatedstring) - 1); 1009 } 1010 return $nullterminatedstring; 1011 } 1012} 1013 1014if (!function_exists('FileSizeNiceDisplay')) { 1015 function FileSizeNiceDisplay($filesize, $precision=2) { 1016 if ($filesize < 1000) { 1017 $sizeunit = 'bytes'; 1018 $precision = 0; 1019 } else { 1020 $filesize /= 1024; 1021 $sizeunit = 'kB'; 1022 } 1023 if ($filesize >= 1000) { 1024 $filesize /= 1024; 1025 $sizeunit = 'MB'; 1026 } 1027 if ($filesize >= 1000) { 1028 $filesize /= 1024; 1029 $sizeunit = 'GB'; 1030 } 1031 return number_format($filesize, $precision).' '.$sizeunit; 1032 } 1033} 1034 1035if (!function_exists('DOStime2UNIXtime')) { 1036 function DOStime2UNIXtime($DOSdate, $DOStime) { 1037 // wFatDate 1038 // Specifies the MS-DOS date. The date is a packed 16-bit value with the following format: 1039 // Bits Contents 1040 // 0-4 Day of the month (1-31) 1041 // 5-8 Month (1 = January, 2 = February, and so on) 1042 // 9-15 Year offset from 1980 (add 1980 to get actual year) 1043 1044 $UNIXday = ($DOSdate & 0x001F); 1045 $UNIXmonth = (($DOSdate & 0x01E0) >> 5); 1046 $UNIXyear = (($DOSdate & 0xFE00) >> 9) + 1980; 1047 1048 // wFatTime 1049 // Specifies the MS-DOS time. The time is a packed 16-bit value with the following format: 1050 // Bits Contents 1051 // 0-4 Second divided by 2 1052 // 5-10 Minute (0-59) 1053 // 11-15 Hour (0-23 on a 24-hour clock) 1054 1055 $UNIXsecond = ($DOStime & 0x001F) * 2; 1056 $UNIXminute = (($DOStime & 0x07E0) >> 5); 1057 $UNIXhour = (($DOStime & 0xF800) >> 11); 1058 1059 return mktime($UNIXhour, $UNIXminute, $UNIXsecond, $UNIXmonth, $UNIXday, $UNIXyear); 1060 } 1061} 1062 1063if (!function_exists('CreateDeepArray')) { 1064 function CreateDeepArray($ArrayPath, $Separator, $Value) { 1065 // assigns $Value to a nested array path: 1066 // $foo = CreateDeepArray('/path/to/my', '/', 'file.txt') 1067 // is the same as: 1068 // $foo = array('path'=>array('to'=>'array('my'=>array('file.txt')))); 1069 // or 1070 // $foo['path']['to']['my'] = 'file.txt'; 1071 while ($ArrayPath[0] == $Separator) { 1072 $ArrayPath = substr($ArrayPath, 1); 1073 } 1074 if (($pos = strpos($ArrayPath, $Separator)) !== false) { 1075 $ReturnedArray[substr($ArrayPath, 0, $pos)] = CreateDeepArray(substr($ArrayPath, $pos + 1), $Separator, $Value); 1076 } else { 1077 $ReturnedArray["$ArrayPath"] = $Value; 1078 } 1079 return $ReturnedArray; 1080 } 1081} 1082 1083if (!function_exists('md5_data')) { 1084 // Allan Hansen <ah@artemis.dk> 1085 // md5_data() - returns md5sum for a file from startuing position to absolute end position 1086 1087 function md5_data($file, $offset, $end, $invertsign=false) { 1088 // first try and create a temporary file in the same directory as the file being scanned 1089 if (($dataMD5filename = tempnam(dirname($file), preg_replace('#[^[:alnum:]]#i', '', basename($file)))) === false) { 1090 // if that fails, create a temporary file in the system temp directory 1091 if (($dataMD5filename = tempnam('/tmp', 'getID3')) === false) { 1092 // if that fails, create a temporary file in the current directory 1093 if (($dataMD5filename = tempnam('.', preg_replace('#[^[:alnum:]]#i', '', basename($file)))) === false) { 1094 // can't find anywhere to create a temp file, just die 1095 return false; 1096 } 1097 } 1098 } 1099 $md5 = false; 1100 set_time_limit(max(filesize($file) / 1000000, 30)); 1101 1102 // copy parts of file 1103 ob_start(); 1104 if ($fp = fopen($file, 'rb')) { 1105 ob_end_clean(); 1106 1107 ob_start(); 1108 if ($MD5fp = fopen($dataMD5filename, 'wb')) { 1109 1110 ob_end_clean(); 1111 if ($invertsign) { 1112 // Load conversion lookup strings for 8-bit unsigned->signed conversion below 1113 $from = ''; 1114 $to = ''; 1115 for ($i = 0; $i < 128; $i++) { 1116 $from .= chr($i); 1117 $to .= chr($i + 128); 1118 } 1119 for ($i = 128; $i < 256; $i++) { 1120 $from .= chr($i); 1121 $to .= chr($i - 128); 1122 } 1123 } 1124 1125 fseek($fp, $offset, SEEK_SET); 1126 $byteslefttowrite = $end - $offset; 1127 while (($byteslefttowrite > 0) && ($buffer = fread($fp, 32768))) { 1128 if ($invertsign) { 1129 // Possibly FLAC-specific (?) 1130 // FLAC calculates the MD5sum of the source data of 8-bit files 1131 // not on the actual byte values in the source file, but of those 1132 // values converted from unsigned to signed, or more specifcally, 1133 // with the MSB inverted. ex: 01 -> 81; F5 -> 75; etc 1134 1135 // Therefore, 8-bit WAV data has to be converted before getting the 1136 // md5_data value so as to match the FLAC value 1137 1138 // Flip the MSB for each byte in the buffer before copying 1139 $buffer = strtr($buffer, $from, $to); 1140 } 1141 $byteswritten = fwrite($MD5fp, $buffer, $byteslefttowrite); 1142 $byteslefttowrite -= $byteswritten; 1143 } 1144 fclose($MD5fp); 1145 $md5 = md5_file($dataMD5filename); 1146 1147 } else { 1148 $errormessage = ob_get_contents(); 1149 ob_end_clean(); 1150 } 1151 fclose($fp); 1152 1153 } else { 1154 $errormessage = ob_get_contents(); 1155 ob_end_clean(); 1156 } 1157 unlink($dataMD5filename); 1158 return $md5; 1159 } 1160} 1161 1162if (!function_exists('TwosCompliment2Decimal')) { 1163 function TwosCompliment2Decimal($BinaryValue) { 1164 // http://sandbox.mc.edu/~bennet/cs110/tc/tctod.html 1165 // First check if the number is negative or positive by looking at the sign bit. 1166 // If it is positive, simply convert it to decimal. 1167 // If it is negative, make it positive by inverting the bits and adding one. 1168 // Then, convert the result to decimal. 1169 // The negative of this number is the value of the original binary. 1170 1171 if ($BinaryValue & 0x80) { 1172 1173 // negative number 1174 return (0 - ((~$BinaryValue & 0xFF) + 1)); 1175 1176 } else { 1177 1178 // positive number 1179 return $BinaryValue; 1180 1181 } 1182 1183 } 1184} 1185 1186if (!function_exists('LastArrayElement')) { 1187 function LastArrayElement($MyArray) { 1188 if (!is_array($MyArray)) { 1189 return false; 1190 } 1191 if (empty($MyArray)) { 1192 return null; 1193 } 1194 foreach ($MyArray as $key => $value) { 1195 } 1196 return $value; 1197 } 1198} 1199 1200if (!function_exists('safe_inc')) { 1201 function safe_inc(&$variable, $increment=1) { 1202 if (isset($variable)) { 1203 $variable += $increment; 1204 } else { 1205 $variable = $increment; 1206 } 1207 return true; 1208 } 1209} 1210 1211if (!function_exists('CalculateCompressionRatioVideo')) { 1212 function CalculateCompressionRatioVideo(&$ThisFileInfo) { 1213 if (empty($ThisFileInfo['video'])) { 1214 return false; 1215 } 1216 if (empty($ThisFileInfo['video']['resolution_x']) || empty($ThisFileInfo['video']['resolution_y'])) { 1217 return false; 1218 } 1219 if (empty($ThisFileInfo['video']['bits_per_sample'])) { 1220 return false; 1221 } 1222 1223 switch ($ThisFileInfo['video']['dataformat']) { 1224 case 'bmp': 1225 case 'gif': 1226 case 'jpeg': 1227 case 'jpg': 1228 case 'png': 1229 case 'tiff': 1230 $FrameRate = 1; 1231 $PlaytimeSeconds = 1; 1232 $BitrateCompressed = $ThisFileInfo['filesize'] * 8; 1233 break; 1234 1235 default: 1236 if (!empty($ThisFileInfo['video']['frame_rate'])) { 1237 $FrameRate = $ThisFileInfo['video']['frame_rate']; 1238 } else { 1239 return false; 1240 } 1241 if (!empty($ThisFileInfo['playtime_seconds'])) { 1242 $PlaytimeSeconds = $ThisFileInfo['playtime_seconds']; 1243 } else { 1244 return false; 1245 } 1246 if (!empty($ThisFileInfo['video']['bitrate'])) { 1247 $BitrateCompressed = $ThisFileInfo['video']['bitrate']; 1248 } else { 1249 return false; 1250 } 1251 break; 1252 } 1253 $BitrateUncompressed = $ThisFileInfo['video']['resolution_x'] * $ThisFileInfo['video']['resolution_y'] * $ThisFileInfo['video']['bits_per_sample'] * $FrameRate; 1254 1255 $ThisFileInfo['video']['compression_ratio'] = $BitrateCompressed / $BitrateUncompressed; 1256 return true; 1257 } 1258} 1259 1260if (!function_exists('CalculateCompressionRatioAudio')) { 1261 function CalculateCompressionRatioAudio(&$ThisFileInfo) { 1262 if (empty($ThisFileInfo['audio']['bitrate']) || empty($ThisFileInfo['audio']['channels']) || empty($ThisFileInfo['audio']['sample_rate']) || empty($ThisFileInfo['audio']['bits_per_sample'])) { 1263 return false; 1264 } 1265 $ThisFileInfo['audio']['compression_ratio'] = $ThisFileInfo['audio']['bitrate'] / ($ThisFileInfo['audio']['channels'] * $ThisFileInfo['audio']['sample_rate'] * $ThisFileInfo['audio']['bits_per_sample']); 1266 return true; 1267 } 1268} 1269 1270if (!function_exists('IsValidMIMEstring')) { 1271 function IsValidMIMEstring($mimestring) { 1272 if ((strlen($mimestring) >= 3) && (strpos($mimestring, '/') > 0) && (strpos($mimestring, '/') < (strlen($mimestring) - 1))) { 1273 return true; 1274 } 1275 return false; 1276 } 1277} 1278 1279if (!function_exists('IsWithinBitRange')) { 1280 function IsWithinBitRange($number, $maxbits, $signed=false) { 1281 if ($signed) { 1282 if (($number > (0 - pow(2, $maxbits - 1))) && ($number <= pow(2, $maxbits - 1))) { 1283 return true; 1284 } 1285 } else { 1286 if (($number >= 0) && ($number <= pow(2, $maxbits))) { 1287 return true; 1288 } 1289 } 1290 return false; 1291 } 1292} 1293 1294if (!function_exists('safe_parse_url')) { 1295 function safe_parse_url($url) { 1296 ob_start(); 1297 $parts = parse_url($url); 1298 $errormessage = ob_get_contents(); 1299 ob_end_clean(); 1300 $parts['scheme'] = (isset($parts['scheme']) ? $parts['scheme'] : ''); 1301 $parts['host'] = (isset($parts['host']) ? $parts['host'] : ''); 1302 $parts['user'] = (isset($parts['user']) ? $parts['user'] : ''); 1303 $parts['pass'] = (isset($parts['pass']) ? $parts['pass'] : ''); 1304 $parts['path'] = (isset($parts['path']) ? $parts['path'] : ''); 1305 $parts['query'] = (isset($parts['query']) ? $parts['query'] : ''); 1306 return $parts; 1307 } 1308} 1309 1310if (!function_exists('IsValidURL')) { 1311 function IsValidURL($url, $allowUserPass=false) { 1312 if ($url == '') { 1313 return false; 1314 } 1315 if ($allowUserPass !== true) { 1316 if (strstr($url, '@')) { 1317 // in the format http://user:pass@example.com or http://user@example.com 1318 // but could easily be somebody incorrectly entering an email address in place of a URL 1319 return false; 1320 } 1321 } 1322 if ($parts = safe_parse_url($url)) { 1323 if (($parts['scheme'] != 'http') && ($parts['scheme'] != 'https') && ($parts['scheme'] != 'ftp') && ($parts['scheme'] != 'gopher')) { 1324 return false; 1325 } elseif (!preg_match("#^[[:alnum:]]([-.]?[0-9a-z])*\.[a-z]{2,3}#i$", $parts['host'], $regs) && !preg_match('#^[0-9]{1,3}(\.[0-9]{1,3}){3}$#', $parts['host'])) { 1326 return false; 1327 } elseif (!preg_match("#^([[:alnum:]-]|[\_])*$#i", $parts['user'], $regs)) { 1328 return false; 1329 } elseif (!preg_match("#^([[:alnum:]-]|[\_])*$#i", $parts['pass'], $regs)) { 1330 return false; 1331 } elseif (!preg_match("#^[[:alnum:]/_\.@~-]*$#i", $parts['path'], $regs)) { 1332 return false; 1333 } elseif (!preg_match("#^[[:alnum:]?&=+:;_()%#/,\.-]*$#i", $parts['query'], $regs)) { 1334 return false; 1335 } else { 1336 return true; 1337 } 1338 } 1339 return false; 1340 } 1341} 1342 1343echo '<form action="'.htmlentities($_SERVER['PHP_SELF'], ENT_QUOTES).'" method="get">'; 1344echo 'Enter 4 hex bytes of MPEG-audio header (ie <I>FF FA 92 44</I>)<BR>'; 1345echo '<input type="text" name="HeaderHexBytes" value="'.htmlentities(isset($_POST['HeaderHexBytes']) ? strtoupper($_POST['HeaderHexBytes']) : '', ENT_QUOTES).'" size="11" maxlength="11">'; 1346echo '<input type="submit" name="Analyze" value="Analyze"></form>'; 1347echo '<hr>'; 1348 1349echo '<form action="'.htmlentities($_SERVER['PHP_SELF'], ENT_QUOTES).'" method="get">'; 1350echo 'Generate a MPEG-audio 4-byte header from these values:<BR>'; 1351echo '<table border="0">'; 1352 1353$MPEGgenerateValues = array( 1354 'version' => array('1', '2', '2.5'), 1355 'layer' => array('I', 'II', 'III'), 1356 'protection' => array('Y', 'N'), 1357 'bitrate' => array('free', '8', '16', '24', '32', '40', '48', '56', '64', '80', '96', '112', '128', '144', '160', '176', '192', '224', '256', '288', '320', '352', '384', '416', '448'), 1358 'frequency' => array('8000', '11025', '12000', '16000', '22050', '24000', '32000', '44100', '48000'), 1359 'padding' => array('Y', 'N'), 1360 'private' => array('Y', 'N'), 1361 'channelmode' => array('stereo', 'joint stereo', 'dual channel', 'mono'), 1362 'modeextension' => array('none', 'IS', 'MS', 'IS+MS', '4-31', '8-31', '12-31', '16-31'), 1363 'copyright' => array('Y', 'N'), 1364 'original' => array('Y', 'N'), 1365 'emphasis' => array('none', '50/15ms', 'CCIT J.17'), 1366); 1367 1368foreach ($MPEGgenerateValues as $name => $dataarray) { 1369 echo '<tr><th>'.$name.':</th><td><select name="'.$name.'">'; 1370 foreach ($dataarray as $key => $value) { 1371 echo '<option'.((isset($_POST["$name"]) && ($_POST["$name"] == $value)) ? ' SELECTED' : '').'>'.$value.'</option>'; 1372 } 1373 echo '</select></td></tr>'; 1374} 1375 1376if (isset($_POST['bitrate'])) { 1377 echo '<tr><th>Frame Length:</th><td>'.(int) MPEGaudioFrameLength($_POST['bitrate'], $_POST['version'], $_POST['layer'], (($_POST['padding'] == 'Y') ? '1' : '0'), $_POST['frequency']).'</td></tr>'; 1378} 1379echo '</table>'; 1380echo '<input type="submit" name="Generate" value="Generate"></form>'; 1381echo '<hr>'; 1382 1383 1384if (isset($_POST['Analyze']) && $_POST['HeaderHexBytes']) { 1385 1386 $headerbytearray = explode(' ', $_POST['HeaderHexBytes']); 1387 if (count($headerbytearray) != 4) { 1388 die('Invalid byte pattern'); 1389 } 1390 $headerstring = ''; 1391 foreach ($headerbytearray as $textbyte) { 1392 $headerstring .= chr(hexdec($textbyte)); 1393 } 1394 1395 $MP3fileInfo['error'] = ''; 1396 1397 $MPEGheaderRawArray = MPEGaudioHeaderDecode(substr($headerstring, 0, 4)); 1398 1399 if (MPEGaudioHeaderValid($MPEGheaderRawArray, true)) { 1400 1401 $MP3fileInfo['raw'] = $MPEGheaderRawArray; 1402 1403 $MP3fileInfo['version'] = MPEGaudioVersionLookup($MP3fileInfo['raw']['version']); 1404 $MP3fileInfo['layer'] = MPEGaudioLayerLookup($MP3fileInfo['raw']['layer']); 1405 $MP3fileInfo['protection'] = MPEGaudioCRCLookup($MP3fileInfo['raw']['protection']); 1406 $MP3fileInfo['bitrate'] = MPEGaudioBitrateLookup($MP3fileInfo['version'], $MP3fileInfo['layer'], $MP3fileInfo['raw']['bitrate']); 1407 $MP3fileInfo['frequency'] = MPEGaudioFrequencyLookup($MP3fileInfo['version'], $MP3fileInfo['raw']['sample_rate']); 1408 $MP3fileInfo['padding'] = (bool) $MP3fileInfo['raw']['padding']; 1409 $MP3fileInfo['private'] = (bool) $MP3fileInfo['raw']['private']; 1410 $MP3fileInfo['channelmode'] = MPEGaudioChannelModeLookup($MP3fileInfo['raw']['channelmode']); 1411 $MP3fileInfo['channels'] = (($MP3fileInfo['channelmode'] == 'mono') ? 1 : 2); 1412 $MP3fileInfo['modeextension'] = MPEGaudioModeExtensionLookup($MP3fileInfo['layer'], $MP3fileInfo['raw']['modeextension']); 1413 $MP3fileInfo['copyright'] = (bool) $MP3fileInfo['raw']['copyright']; 1414 $MP3fileInfo['original'] = (bool) $MP3fileInfo['raw']['original']; 1415 $MP3fileInfo['emphasis'] = MPEGaudioEmphasisLookup($MP3fileInfo['raw']['emphasis']); 1416 1417 if ($MP3fileInfo['protection']) { 1418 $MP3fileInfo['crc'] = BigEndian2Int(substr($headerstring, 4, 2)); 1419 } 1420 1421 if ($MP3fileInfo['frequency'] > 0) { 1422 $MP3fileInfo['framelength'] = MPEGaudioFrameLength($MP3fileInfo['bitrate'], $MP3fileInfo['version'], $MP3fileInfo['layer'], (int) $MP3fileInfo['padding'], $MP3fileInfo['frequency']); 1423 } 1424 if ($MP3fileInfo['bitrate'] != 'free') { 1425 $MP3fileInfo['bitrate'] *= 1000; 1426 } 1427 1428 } else { 1429 1430 $MP3fileInfo['error'] .= "\n".'Invalid MPEG audio header'; 1431 1432 } 1433 1434 if (!$MP3fileInfo['error']) { 1435 unset($MP3fileInfo['error']); 1436 } 1437 1438 echo table_var_dump($MP3fileInfo); 1439 1440} elseif (isset($_POST['Generate'])) { 1441 1442 // AAAA AAAA AAAB BCCD EEEE FFGH IIJJ KLMM 1443 1444 $headerbitstream = '11111111111'; // A - Frame sync (all bits set) 1445 1446 $MPEGversionLookup = array('2.5'=>'00', '2'=>'10', '1'=>'11'); 1447 $headerbitstream .= $MPEGversionLookup[$_POST['version']]; // B - MPEG Audio version ID 1448 1449 $MPEGlayerLookup = array('III'=>'01', 'II'=>'10', 'I'=>'11'); 1450 $headerbitstream .= $MPEGlayerLookup[$_POST['layer']]; // C - Layer description 1451 1452 $headerbitstream .= (($_POST['protection'] == 'Y') ? '0' : '1'); // D - Protection bit 1453 1454 $MPEGaudioBitrateLookup['1']['I'] = array('free'=>'0000', '32'=>'0001', '64'=>'0010', '96'=>'0011', '128'=>'0100', '160'=>'0101', '192'=>'0110', '224'=>'0111', '256'=>'1000', '288'=>'1001', '320'=>'1010', '352'=>'1011', '384'=>'1100', '416'=>'1101', '448'=>'1110'); 1455 $MPEGaudioBitrateLookup['1']['II'] = array('free'=>'0000', '32'=>'0001', '48'=>'0010', '56'=>'0011', '64'=>'0100', '80'=>'0101', '96'=>'0110', '112'=>'0111', '128'=>'1000', '160'=>'1001', '192'=>'1010', '224'=>'1011', '256'=>'1100', '320'=>'1101', '384'=>'1110'); 1456 $MPEGaudioBitrateLookup['1']['III'] = array('free'=>'0000', '32'=>'0001', '40'=>'0010', '48'=>'0011', '56'=>'0100', '64'=>'0101', '80'=>'0110', '96'=>'0111', '112'=>'1000', '128'=>'1001', '160'=>'1010', '192'=>'1011', '224'=>'1100', '256'=>'1101', '320'=>'1110'); 1457 $MPEGaudioBitrateLookup['2']['I'] = array('free'=>'0000', '32'=>'0001', '48'=>'0010', '56'=>'0011', '64'=>'0100', '80'=>'0101', '96'=>'0110', '112'=>'0111', '128'=>'1000', '144'=>'1001', '160'=>'1010', '176'=>'1011', '192'=>'1100', '224'=>'1101', '256'=>'1110'); 1458 $MPEGaudioBitrateLookup['2']['II'] = array('free'=>'0000', '8'=>'0001', '16'=>'0010', '24'=>'0011', '32'=>'0100', '40'=>'0101', '48'=>'0110', '56'=>'0111', '64'=>'1000', '80'=>'1001', '96'=>'1010', '112'=>'1011', '128'=>'1100', '144'=>'1101', '160'=>'1110'); 1459 $MPEGaudioBitrateLookup['2']['III'] = $MPEGaudioBitrateLookup['2']['II']; 1460 $MPEGaudioBitrateLookup['2.5']['I'] = $MPEGaudioBitrateLookup['2']['I']; 1461 $MPEGaudioBitrateLookup['2.5']['II'] = $MPEGaudioBitrateLookup['2']['II']; 1462 $MPEGaudioBitrateLookup['2.5']['III'] = $MPEGaudioBitrateLookup['2']['II']; 1463 if (isset($MPEGaudioBitrateLookup[$_POST['version']][$_POST['layer']][$_POST['bitrate']])) { 1464 $headerbitstream .= $MPEGaudioBitrateLookup[$_POST['version']][$_POST['layer']][$_POST['bitrate']]; // E - Bitrate index 1465 } else { 1466 die('Invalid <B>Bitrate</B>'); 1467 } 1468 1469 $MPEGaudioFrequencyLookup['1'] = array('44100'=>'00', '48000'=>'01', '32000'=>'10'); 1470 $MPEGaudioFrequencyLookup['2'] = array('22050'=>'00', '24000'=>'01', '16000'=>'10'); 1471 $MPEGaudioFrequencyLookup['2.5'] = array('11025'=>'00', '12000'=>'01', '8000'=>'10'); 1472 if (isset($MPEGaudioFrequencyLookup[$_POST['version']][$_POST['frequency']])) { 1473 $headerbitstream .= $MPEGaudioFrequencyLookup[$_POST['version']][$_POST['frequency']]; // F - Sampling rate frequency index 1474 } else { 1475 die('Invalid <B>Frequency</B>'); 1476 } 1477 1478 $headerbitstream .= (($_POST['padding'] == 'Y') ? '1' : '0'); // G - Padding bit 1479 1480 $headerbitstream .= (($_POST['private'] == 'Y') ? '1' : '0'); // H - Private bit 1481 1482 $MPEGaudioChannelModeLookup = array('stereo'=>'00', 'joint stereo'=>'01', 'dual channel'=>'10', 'mono'=>'11'); 1483 $headerbitstream .= $MPEGaudioChannelModeLookup[$_POST['channelmode']]; // I - Channel Mode 1484 1485 $MPEGaudioModeExtensionLookup['I'] = array('4-31'=>'00', '8-31'=>'01', '12-31'=>'10', '16-31'=>'11'); 1486 $MPEGaudioModeExtensionLookup['II'] = $MPEGaudioModeExtensionLookup['I']; 1487 $MPEGaudioModeExtensionLookup['III'] = array('none'=>'00', 'IS'=>'01', 'MS'=>'10', 'IS+MS'=>'11'); 1488 if ($_POST['channelmode'] != 'joint stereo') { 1489 $headerbitstream .= '00'; 1490 } elseif (isset($MPEGaudioModeExtensionLookup[$_POST['layer']][$_POST['modeextension']])) { 1491 $headerbitstream .= $MPEGaudioModeExtensionLookup[$_POST['layer']][$_POST['modeextension']]; // J - Mode extension (Only if Joint stereo) 1492 } else { 1493 die('Invalid <B>Mode Extension</B>'); 1494 } 1495 1496 $headerbitstream .= (($_POST['copyright'] == 'Y') ? '1' : '0'); // K - Copyright 1497 1498 $headerbitstream .= (($_POST['original'] == 'Y') ? '1' : '0'); // L - Original 1499 1500 $MPEGaudioEmphasisLookup = array('none'=>'00', '50/15ms'=>'01', 'CCIT J.17'=>'11'); 1501 if (isset($MPEGaudioEmphasisLookup[$_POST['emphasis']])) { 1502 $headerbitstream .= $MPEGaudioEmphasisLookup[$_POST['emphasis']]; // M - Emphasis 1503 } else { 1504 die('Invalid <B>Emphasis</B>'); 1505 } 1506 1507 echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 0, 8))), 2, '0', STR_PAD_LEFT)).' '; 1508 echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 8, 8))), 2, '0', STR_PAD_LEFT)).' '; 1509 echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 16, 8))), 2, '0', STR_PAD_LEFT)).' '; 1510 echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 24, 8))), 2, '0', STR_PAD_LEFT)).'<BR>'; 1511 1512} 1513 1514function MPEGaudioVersionLookup($rawversion) { 1515 $MPEGaudioVersionLookup = array('2.5', FALSE, '2', '1'); 1516 return (isset($MPEGaudioVersionLookup["$rawversion"]) ? $MPEGaudioVersionLookup["$rawversion"] : FALSE); 1517} 1518 1519function MPEGaudioLayerLookup($rawlayer) { 1520 $MPEGaudioLayerLookup = array(FALSE, 'III', 'II', 'I'); 1521 return (isset($MPEGaudioLayerLookup["$rawlayer"]) ? $MPEGaudioLayerLookup["$rawlayer"] : FALSE); 1522} 1523 1524function MPEGaudioBitrateLookup($version, $layer, $rawbitrate) { 1525 static $MPEGaudioBitrateLookup; 1526 if (empty($MPEGaudioBitrateLookup)) { 1527 $MPEGaudioBitrateLookup = MPEGaudioBitrateArray(); 1528 } 1529 return (isset($MPEGaudioBitrateLookup["$version"]["$layer"]["$rawbitrate"]) ? $MPEGaudioBitrateLookup["$version"]["$layer"]["$rawbitrate"] : FALSE); 1530} 1531 1532function MPEGaudioFrequencyLookup($version, $rawfrequency) { 1533 static $MPEGaudioFrequencyLookup; 1534 if (empty($MPEGaudioFrequencyLookup)) { 1535 $MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray(); 1536 } 1537 return (isset($MPEGaudioFrequencyLookup["$version"]["$rawfrequency"]) ? $MPEGaudioFrequencyLookup["$version"]["$rawfrequency"] : FALSE); 1538} 1539 1540function MPEGaudioChannelModeLookup($rawchannelmode) { 1541 $MPEGaudioChannelModeLookup = array('stereo', 'joint stereo', 'dual channel', 'mono'); 1542 return (isset($MPEGaudioChannelModeLookup["$rawchannelmode"]) ? $MPEGaudioChannelModeLookup["$rawchannelmode"] : FALSE); 1543} 1544 1545function MPEGaudioModeExtensionLookup($layer, $rawmodeextension) { 1546 $MPEGaudioModeExtensionLookup['I'] = array('4-31', '8-31', '12-31', '16-31'); 1547 $MPEGaudioModeExtensionLookup['II'] = array('4-31', '8-31', '12-31', '16-31'); 1548 $MPEGaudioModeExtensionLookup['III'] = array('', 'IS', 'MS', 'IS+MS'); 1549 return (isset($MPEGaudioModeExtensionLookup["$layer"]["$rawmodeextension"]) ? $MPEGaudioModeExtensionLookup["$layer"]["$rawmodeextension"] : FALSE); 1550} 1551 1552function MPEGaudioEmphasisLookup($rawemphasis) { 1553 $MPEGaudioEmphasisLookup = array('none', '50/15ms', FALSE, 'CCIT J.17'); 1554 return (isset($MPEGaudioEmphasisLookup["$rawemphasis"]) ? $MPEGaudioEmphasisLookup["$rawemphasis"] : FALSE); 1555} 1556 1557function MPEGaudioCRCLookup($CRCbit) { 1558 // inverse boolean cast :) 1559 if ($CRCbit == '0') { 1560 return TRUE; 1561 } else { 1562 return FALSE; 1563 } 1564} 1565 1566///////////////////////////////////////////////////////////////// 1567/// getID3() by James Heinrich <info@getid3.org> // 1568// available at http://getid3.sourceforge.net /// 1569// or https://www.getid3.org /// 1570///////////////////////////////////////////////////////////////// 1571// // 1572// getid3.mp3.php - part of getID3() // 1573// See getid3.readme.txt for more details // 1574// // 1575///////////////////////////////////////////////////////////////// 1576 1577// number of frames to scan to determine if MPEG-audio sequence is valid 1578// Lower this number to 5-20 for faster scanning 1579// Increase this number to 50+ for most accurate detection of valid VBR/CBR 1580// mpeg-audio streams 1581define('MPEG_VALID_CHECK_FRAMES', 35); 1582 1583function getMP3headerFilepointer(&$fd, &$ThisFileInfo) { 1584 1585 getOnlyMPEGaudioInfo($fd, $ThisFileInfo, $ThisFileInfo['avdataoffset']); 1586 1587 if (isset($ThisFileInfo['mpeg']['audio']['bitrate_mode'])) { 1588 $ThisFileInfo['audio']['bitrate_mode'] = strtolower($ThisFileInfo['mpeg']['audio']['bitrate_mode']); 1589 } 1590 1591 if (((isset($ThisFileInfo['id3v2']) && ($ThisFileInfo['avdataoffset'] > $ThisFileInfo['id3v2']['headerlength'])) || (!isset($ThisFileInfo['id3v2']) && ($ThisFileInfo['avdataoffset'] > 0)))) { 1592 1593 $ThisFileInfo['warning'] .= "\n".'Unknown data before synch '; 1594 if (isset($ThisFileInfo['id3v2']['headerlength'])) { 1595 $ThisFileInfo['warning'] .= '(ID3v2 header ends at '.$ThisFileInfo['id3v2']['headerlength'].', then '.($ThisFileInfo['avdataoffset'] - $ThisFileInfo['id3v2']['headerlength']).' bytes garbage, '; 1596 } else { 1597 $ThisFileInfo['warning'] .= '(should be at beginning of file, '; 1598 } 1599 $ThisFileInfo['warning'] .= 'synch detected at '.$ThisFileInfo['avdataoffset'].')'; 1600 if ($ThisFileInfo['audio']['bitrate_mode'] == 'cbr') { 1601 if (!empty($ThisFileInfo['id3v2']['headerlength']) && (($ThisFileInfo['avdataoffset'] - $ThisFileInfo['id3v2']['headerlength']) == $ThisFileInfo['mpeg']['audio']['framelength'])) { 1602 $ThisFileInfo['warning'] .= '. This is a known problem with some versions of LAME (3.91, 3.92) DLL in CBR mode.'; 1603 $ThisFileInfo['audio']['codec'] = 'LAME'; 1604 } elseif (empty($ThisFileInfo['id3v2']['headerlength']) && ($ThisFileInfo['avdataoffset'] == $ThisFileInfo['mpeg']['audio']['framelength'])) { 1605 $ThisFileInfo['warning'] .= '. This is a known problem with some versions of LAME (3.91, 3.92) DLL in CBR mode.'; 1606 $ThisFileInfo['audio']['codec'] = 'LAME'; 1607 } 1608 } 1609 1610 } 1611 1612 if (isset($ThisFileInfo['mpeg']['audio']['layer']) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'II')) { 1613 $ThisFileInfo['audio']['dataformat'] = 'mp2'; 1614 } elseif (isset($ThisFileInfo['mpeg']['audio']['layer']) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'I')) { 1615 $ThisFileInfo['audio']['dataformat'] = 'mp1'; 1616 } 1617 if ($ThisFileInfo['fileformat'] == 'mp3') { 1618 switch ($ThisFileInfo['audio']['dataformat']) { 1619 case 'mp1': 1620 case 'mp2': 1621 case 'mp3': 1622 $ThisFileInfo['fileformat'] = $ThisFileInfo['audio']['dataformat']; 1623 break; 1624 1625 default: 1626 $ThisFileInfo['warning'] .= "\n".'Expecting [audio][dataformat] to be mp1/mp2/mp3 when fileformat == mp3, [audio][dataformat] actually "'.$ThisFileInfo['audio']['dataformat'].'"'; 1627 break; 1628 } 1629 } 1630 1631 if (empty($ThisFileInfo['fileformat'])) { 1632 $ThisFileInfo['error'] .= "\n".'Synch not found'; 1633 unset($ThisFileInfo['fileformat']); 1634 unset($ThisFileInfo['audio']['bitrate_mode']); 1635 unset($ThisFileInfo['avdataoffset']); 1636 unset($ThisFileInfo['avdataend']); 1637 return false; 1638 } 1639 1640 $ThisFileInfo['mime_type'] = 'audio/mpeg'; 1641 $ThisFileInfo['audio']['lossless'] = false; 1642 1643 // Calculate playtime 1644 if (!isset($ThisFileInfo['playtime_seconds']) && isset($ThisFileInfo['audio']['bitrate']) && ($ThisFileInfo['audio']['bitrate'] > 0)) { 1645 $ThisFileInfo['playtime_seconds'] = ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']) * 8 / $ThisFileInfo['audio']['bitrate']; 1646 } 1647 1648 if (isset($ThisFileInfo['mpeg']['audio']['LAME'])) { 1649 $ThisFileInfo['audio']['codec'] = 'LAME'; 1650 if (!empty($ThisFileInfo['mpeg']['audio']['LAME']['long_version'])) { 1651 $ThisFileInfo['audio']['encoder'] = trim($ThisFileInfo['mpeg']['audio']['LAME']['long_version']); 1652 } 1653 } 1654 1655 return true; 1656} 1657 1658 1659function decodeMPEGaudioHeader($fd, $offset, &$ThisFileInfo, $recursivesearch=true, $ScanAsCBR=false, $FastMPEGheaderScan=false) { 1660 1661 static $MPEGaudioVersionLookup; 1662 static $MPEGaudioLayerLookup; 1663 static $MPEGaudioBitrateLookup; 1664 static $MPEGaudioFrequencyLookup; 1665 static $MPEGaudioChannelModeLookup; 1666 static $MPEGaudioModeExtensionLookup; 1667 static $MPEGaudioEmphasisLookup; 1668 if (empty($MPEGaudioVersionLookup)) { 1669 $MPEGaudioVersionLookup = MPEGaudioVersionArray(); 1670 $MPEGaudioLayerLookup = MPEGaudioLayerArray(); 1671 $MPEGaudioBitrateLookup = MPEGaudioBitrateArray(); 1672 $MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray(); 1673 $MPEGaudioChannelModeLookup = MPEGaudioChannelModeArray(); 1674 $MPEGaudioModeExtensionLookup = MPEGaudioModeExtensionArray(); 1675 $MPEGaudioEmphasisLookup = MPEGaudioEmphasisArray(); 1676 } 1677 1678 if ($offset >= $ThisFileInfo['avdataend']) { 1679 $ThisFileInfo['error'] .= "\n".'end of file encounter looking for MPEG synch'; 1680 return false; 1681 } 1682 fseek($fd, $offset, SEEK_SET); 1683 $headerstring = fread($fd, 1441); // worse-case max length = 32kHz @ 320kbps layer 3 = 1441 bytes/frame 1684 1685 // MP3 audio frame structure: 1686 // $aa $aa $aa $aa [$bb $bb] $cc... 1687 // where $aa..$aa is the four-byte mpeg-audio header (below) 1688 // $bb $bb is the optional 2-byte CRC 1689 // and $cc... is the audio data 1690 1691 $head4 = substr($headerstring, 0, 4); 1692 1693 static $MPEGaudioHeaderDecodeCache = array(); 1694 if (isset($MPEGaudioHeaderDecodeCache[$head4])) { 1695 $MPEGheaderRawArray = $MPEGaudioHeaderDecodeCache[$head4]; 1696 } else { 1697 $MPEGheaderRawArray = MPEGaudioHeaderDecode($head4); 1698 $MPEGaudioHeaderDecodeCache[$head4] = $MPEGheaderRawArray; 1699 } 1700 1701 static $MPEGaudioHeaderValidCache = array(); 1702 1703 // Not in cache 1704 if (!isset($MPEGaudioHeaderValidCache[$head4])) { 1705 $MPEGaudioHeaderValidCache[$head4] = MPEGaudioHeaderValid($MPEGheaderRawArray); 1706 } 1707 1708 if ($MPEGaudioHeaderValidCache[$head4]) { 1709 $ThisFileInfo['mpeg']['audio']['raw'] = $MPEGheaderRawArray; 1710 } else { 1711 $ThisFileInfo['error'] .= "\n".'Invalid MPEG audio header at offset '.$offset; 1712 return false; 1713 } 1714 1715 if (!$FastMPEGheaderScan) { 1716 1717 $ThisFileInfo['mpeg']['audio']['version'] = $MPEGaudioVersionLookup[$ThisFileInfo['mpeg']['audio']['raw']['version']]; 1718 $ThisFileInfo['mpeg']['audio']['layer'] = $MPEGaudioLayerLookup[$ThisFileInfo['mpeg']['audio']['raw']['layer']]; 1719 1720 $ThisFileInfo['mpeg']['audio']['channelmode'] = $MPEGaudioChannelModeLookup[$ThisFileInfo['mpeg']['audio']['raw']['channelmode']]; 1721 $ThisFileInfo['mpeg']['audio']['channels'] = (($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') ? 1 : 2); 1722 $ThisFileInfo['mpeg']['audio']['sample_rate'] = $MPEGaudioFrequencyLookup[$ThisFileInfo['mpeg']['audio']['version']][$ThisFileInfo['mpeg']['audio']['raw']['sample_rate']]; 1723 $ThisFileInfo['mpeg']['audio']['protection'] = !$ThisFileInfo['mpeg']['audio']['raw']['protection']; 1724 $ThisFileInfo['mpeg']['audio']['private'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['private']; 1725 $ThisFileInfo['mpeg']['audio']['modeextension'] = $MPEGaudioModeExtensionLookup[$ThisFileInfo['mpeg']['audio']['layer']][$ThisFileInfo['mpeg']['audio']['raw']['modeextension']]; 1726 $ThisFileInfo['mpeg']['audio']['copyright'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['copyright']; 1727 $ThisFileInfo['mpeg']['audio']['original'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['original']; 1728 $ThisFileInfo['mpeg']['audio']['emphasis'] = $MPEGaudioEmphasisLookup[$ThisFileInfo['mpeg']['audio']['raw']['emphasis']]; 1729 1730 $ThisFileInfo['audio']['channels'] = $ThisFileInfo['mpeg']['audio']['channels']; 1731 $ThisFileInfo['audio']['sample_rate'] = $ThisFileInfo['mpeg']['audio']['sample_rate']; 1732 1733 if ($ThisFileInfo['mpeg']['audio']['protection']) { 1734 $ThisFileInfo['mpeg']['audio']['crc'] = BigEndian2Int(substr($headerstring, 4, 2)); 1735 } 1736 1737 } 1738 1739 if ($ThisFileInfo['mpeg']['audio']['raw']['bitrate'] == 15) { 1740 // http://www.hydrogenaudio.org/?act=ST&f=16&t=9682&st=0 1741 $ThisFileInfo['warning'] .= "\n".'Invalid bitrate index (15), this is a known bug in free-format MP3s encoded by LAME v3.90 - 3.93.1'; 1742 $ThisFileInfo['mpeg']['audio']['raw']['bitrate'] = 0; 1743 } 1744 $ThisFileInfo['mpeg']['audio']['padding'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['padding']; 1745 $ThisFileInfo['mpeg']['audio']['bitrate'] = $MPEGaudioBitrateLookup[$ThisFileInfo['mpeg']['audio']['version']][$ThisFileInfo['mpeg']['audio']['layer']][$ThisFileInfo['mpeg']['audio']['raw']['bitrate']]; 1746 1747 if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && ($offset == $ThisFileInfo['avdataoffset'])) { 1748 // only skip multiple frame check if free-format bitstream found at beginning of file 1749 // otherwise is quite possibly simply corrupted data 1750 $recursivesearch = false; 1751 } 1752 1753 // For Layer II there are some combinations of bitrate and mode which are not allowed. 1754 if (!$FastMPEGheaderScan && ($ThisFileInfo['mpeg']['audio']['layer'] == 'II')) { 1755 1756 $ThisFileInfo['audio']['dataformat'] = 'mp2'; 1757 switch ($ThisFileInfo['mpeg']['audio']['channelmode']) { 1758 1759 case 'mono': 1760 if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') || ($ThisFileInfo['mpeg']['audio']['bitrate'] <= 192)) { 1761 // these are ok 1762 } else { 1763 $ThisFileInfo['error'] .= "\n".$ThisFileInfo['mpeg']['audio']['bitrate'].'kbps not allowed in Layer II, '.$ThisFileInfo['mpeg']['audio']['channelmode'].'.'; 1764 return false; 1765 } 1766 break; 1767 1768 case 'stereo': 1769 case 'joint stereo': 1770 case 'dual channel': 1771 if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') || ($ThisFileInfo['mpeg']['audio']['bitrate'] == 64) || ($ThisFileInfo['mpeg']['audio']['bitrate'] >= 96)) { 1772 // these are ok 1773 } else { 1774 $ThisFileInfo['error'] .= "\n".$ThisFileInfo['mpeg']['audio']['bitrate'].'kbps not allowed in Layer II, '.$ThisFileInfo['mpeg']['audio']['channelmode'].'.'; 1775 return false; 1776 } 1777 break; 1778 1779 } 1780 1781 } 1782 1783 1784 if ($ThisFileInfo['audio']['sample_rate'] > 0) { 1785 $ThisFileInfo['mpeg']['audio']['framelength'] = MPEGaudioFrameLength($ThisFileInfo['mpeg']['audio']['bitrate'], $ThisFileInfo['mpeg']['audio']['version'], $ThisFileInfo['mpeg']['audio']['layer'], (int) $ThisFileInfo['mpeg']['audio']['padding'], $ThisFileInfo['audio']['sample_rate']); 1786 } 1787 1788 if ($ThisFileInfo['mpeg']['audio']['bitrate'] != 'free') { 1789 1790 $ThisFileInfo['audio']['bitrate'] = 1000 * $ThisFileInfo['mpeg']['audio']['bitrate']; 1791 1792 if (isset($ThisFileInfo['mpeg']['audio']['framelength'])) { 1793 $nextframetestoffset = $offset + $ThisFileInfo['mpeg']['audio']['framelength']; 1794 } else { 1795 $ThisFileInfo['error'] .= "\n".'Frame at offset('.$offset.') is has an invalid frame length.'; 1796 return false; 1797 } 1798 1799 } 1800 1801 $ExpectedNumberOfAudioBytes = 0; 1802 1803 //////////////////////////////////////////////////////////////////////////////////// 1804 // Variable-bitrate headers 1805 1806 if (substr($headerstring, 4 + 32, 4) == 'VBRI') { 1807 // Fraunhofer VBR header is hardcoded 'VBRI' at offset 0x24 (36) 1808 // specs taken from http://minnie.tuhs.org/pipermail/mp3encoder/2001-January/001800.html 1809 1810 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr'; 1811 $ThisFileInfo['mpeg']['audio']['VBR_method'] = 'Fraunhofer'; 1812 $ThisFileInfo['audio']['codec'] = 'Fraunhofer'; 1813 1814 $SideInfoData = substr($headerstring, 4 + 2, 32); 1815 1816 $FraunhoferVBROffset = 36; 1817 1818 $ThisFileInfo['mpeg']['audio']['VBR_encoder_version'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 4, 2)); 1819 $ThisFileInfo['mpeg']['audio']['VBR_encoder_delay'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 6, 2)); 1820 $ThisFileInfo['mpeg']['audio']['VBR_quality'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 8, 2)); 1821 $ThisFileInfo['mpeg']['audio']['VBR_bytes'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 10, 4)); 1822 $ThisFileInfo['mpeg']['audio']['VBR_frames'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 14, 4)); 1823 $ThisFileInfo['mpeg']['audio']['VBR_seek_offsets'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 18, 2)); 1824 //$ThisFileInfo['mpeg']['audio']['reserved'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 20, 4)); // hardcoded $00 $01 $00 $02 - purpose unknown 1825 $ThisFileInfo['mpeg']['audio']['VBR_seek_offsets_stride'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 24, 2)); 1826 1827 $ExpectedNumberOfAudioBytes = $ThisFileInfo['mpeg']['audio']['VBR_bytes']; 1828 1829 $previousbyteoffset = $offset; 1830 for ($i = 0; $i < $ThisFileInfo['mpeg']['audio']['VBR_seek_offsets']; $i++) { 1831 $Fraunhofer_OffsetN = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset, 2)); 1832 $FraunhoferVBROffset += 2; 1833 $ThisFileInfo['mpeg']['audio']['VBR_offsets_relative'][$i] = $Fraunhofer_OffsetN; 1834 $ThisFileInfo['mpeg']['audio']['VBR_offsets_absolute'][$i] = $Fraunhofer_OffsetN + $previousbyteoffset; 1835 $previousbyteoffset += $Fraunhofer_OffsetN; 1836 } 1837 1838 1839 } else { 1840 1841 // Xing VBR header is hardcoded 'Xing' at a offset 0x0D (13), 0x15 (21) or 0x24 (36) 1842 // depending on MPEG layer and number of channels 1843 1844 if ($ThisFileInfo['mpeg']['audio']['version'] == '1') { 1845 if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') { 1846 // MPEG-1 (mono) 1847 $VBRidOffset = 4 + 17; // 0x15 1848 $SideInfoData = substr($headerstring, 4 + 2, 17); 1849 } else { 1850 // MPEG-1 (stereo, joint-stereo, dual-channel) 1851 $VBRidOffset = 4 + 32; // 0x24 1852 $SideInfoData = substr($headerstring, 4 + 2, 32); 1853 } 1854 } else { // 2 or 2.5 1855 if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') { 1856 // MPEG-2, MPEG-2.5 (mono) 1857 $VBRidOffset = 4 + 9; // 0x0D 1858 $SideInfoData = substr($headerstring, 4 + 2, 9); 1859 } else { 1860 // MPEG-2, MPEG-2.5 (stereo, joint-stereo, dual-channel) 1861 $VBRidOffset = 4 + 17; // 0x15 1862 $SideInfoData = substr($headerstring, 4 + 2, 17); 1863 } 1864 } 1865 1866 if ((substr($headerstring, $VBRidOffset, strlen('Xing')) == 'Xing') || (substr($headerstring, $VBRidOffset, strlen('Info')) == 'Info')) { 1867 // 'Xing' is traditional Xing VBR frame 1868 // 'Info' is LAME-encoded CBR (This was done to avoid CBR files to be recognized as traditional Xing VBR files by some decoders.) 1869 1870 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr'; 1871 $ThisFileInfo['mpeg']['audio']['VBR_method'] = 'Xing'; 1872 1873 $ThisFileInfo['mpeg']['audio']['xing_flags_raw'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 4, 4)); 1874 1875 $ThisFileInfo['mpeg']['audio']['xing_flags']['frames'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000001); 1876 $ThisFileInfo['mpeg']['audio']['xing_flags']['bytes'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000002); 1877 $ThisFileInfo['mpeg']['audio']['xing_flags']['toc'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000004); 1878 $ThisFileInfo['mpeg']['audio']['xing_flags']['vbr_scale'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000008); 1879 1880 if ($ThisFileInfo['mpeg']['audio']['xing_flags']['frames']) { 1881 $ThisFileInfo['mpeg']['audio']['VBR_frames'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 8, 4)); 1882 } 1883 if ($ThisFileInfo['mpeg']['audio']['xing_flags']['bytes']) { 1884 $ThisFileInfo['mpeg']['audio']['VBR_bytes'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 12, 4)); 1885 } 1886 1887 if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && !empty($ThisFileInfo['mpeg']['audio']['VBR_frames']) && !empty($ThisFileInfo['mpeg']['audio']['VBR_bytes'])) { 1888 $framelengthfloat = $ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']; 1889 if ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') { 1890 // BitRate = (((FrameLengthInBytes / 4) - Padding) * SampleRate) / 12 1891 $ThisFileInfo['audio']['bitrate'] = ((($framelengthfloat / 4) - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 12; 1892 } else { 1893 // Bitrate = ((FrameLengthInBytes - Padding) * SampleRate) / 144 1894 $ThisFileInfo['audio']['bitrate'] = (($framelengthfloat - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 144; 1895 } 1896 $ThisFileInfo['mpeg']['audio']['framelength'] = floor($framelengthfloat); 1897 } 1898 1899 if ($ThisFileInfo['mpeg']['audio']['xing_flags']['toc']) { 1900 $LAMEtocData = substr($headerstring, $VBRidOffset + 16, 100); 1901 for ($i = 0; $i < 100; $i++) { 1902 $ThisFileInfo['mpeg']['audio']['toc'][$i] = ord($LAMEtocData[$i]); 1903 } 1904 } 1905 if ($ThisFileInfo['mpeg']['audio']['xing_flags']['vbr_scale']) { 1906 $ThisFileInfo['mpeg']['audio']['VBR_scale'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 116, 4)); 1907 } 1908 1909 // http://gabriel.mp3-tech.org/mp3infotag.html 1910 if (substr($headerstring, $VBRidOffset + 120, 4) == 'LAME') { 1911 $ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = substr($headerstring, $VBRidOffset + 120, 20); 1912 $ThisFileInfo['mpeg']['audio']['LAME']['short_version'] = substr($ThisFileInfo['mpeg']['audio']['LAME']['long_version'], 0, 9); 1913 $ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = rtrim($ThisFileInfo['mpeg']['audio']['LAME']['long_version'], "\x55\xAA"); 1914 1915 if ($ThisFileInfo['mpeg']['audio']['LAME']['short_version'] >= 'LAME3.90.') { 1916 1917 // It the LAME tag was only introduced in LAME v3.90 1918 // http://www.hydrogenaudio.org/?act=ST&f=15&t=9933 1919 1920 // Offsets of various bytes in http://gabriel.mp3-tech.org/mp3infotag.html 1921 // are assuming a 'Xing' identifier offset of 0x24, which is the case for 1922 // MPEG-1 non-mono, but not for other combinations 1923 $LAMEtagOffsetContant = $VBRidOffset - 0x24; 1924 1925 // byte $9B VBR Quality 1926 // This field is there to indicate a quality level, although the scale was not precised in the original Xing specifications. 1927 // Actually overwrites original Xing bytes 1928 unset($ThisFileInfo['mpeg']['audio']['VBR_scale']); 1929 $ThisFileInfo['mpeg']['audio']['LAME']['vbr_quality'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0x9B, 1)); 1930 1931 // bytes $9C-$A4 Encoder short VersionString 1932 $ThisFileInfo['mpeg']['audio']['LAME']['short_version'] = substr($headerstring, $LAMEtagOffsetContant + 0x9C, 9); 1933 $ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = $ThisFileInfo['mpeg']['audio']['LAME']['short_version']; 1934 1935 // byte $A5 Info Tag revision + VBR method 1936 $LAMEtagRevisionVBRmethod = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xA5, 1)); 1937 1938 $ThisFileInfo['mpeg']['audio']['LAME']['tag_revision'] = ($LAMEtagRevisionVBRmethod & 0xF0) >> 4; 1939 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] = $LAMEtagRevisionVBRmethod & 0x0F; 1940 $ThisFileInfo['mpeg']['audio']['LAME']['vbr_method'] = LAMEvbrMethodLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method']); 1941 1942 // byte $A6 Lowpass filter value 1943 $ThisFileInfo['mpeg']['audio']['LAME']['lowpass_frequency'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xA6, 1)) * 100; 1944 1945 // bytes $A7-$AE Replay Gain 1946 // http://privatewww.essex.ac.uk/~djmrob/replaygain/rg_data_format.html 1947 // bytes $A7-$AA : 32 bit floating point "Peak signal amplitude" 1948 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] = BigEndian2Float(substr($headerstring, $LAMEtagOffsetContant + 0xA7, 4)); 1949 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAB, 2)); 1950 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAD, 2)); 1951 1952 if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] == 0) { 1953 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] = false; 1954 } 1955 1956 if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] != 0) { 1957 require_once(GETID3_INCLUDEPATH.'getid3.rgad.php'); 1958 1959 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['name'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0xE000) >> 13; 1960 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['originator'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x1C00) >> 10; 1961 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['sign_bit'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x0200) >> 9; 1962 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['gain_adjust'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x01FF; 1963 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['name'] = RGADnameLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['name']); 1964 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['originator'] = RGADoriginatorLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['originator']); 1965 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['gain_db'] = RGADadjustmentLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['gain_adjust'], $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['sign_bit']); 1966 1967 if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] !== false) { 1968 $ThisFileInfo['replay_gain']['radio']['peak'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude']; 1969 } 1970 $ThisFileInfo['replay_gain']['radio']['originator'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['originator']; 1971 $ThisFileInfo['replay_gain']['radio']['adjustment'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['gain_db']; 1972 } 1973 if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] != 0) { 1974 require_once(GETID3_INCLUDEPATH.'getid3.rgad.php'); 1975 1976 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['name'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0xE000) >> 13; 1977 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['originator'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x1C00) >> 10; 1978 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['sign_bit'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x0200) >> 9; 1979 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['gain_adjust'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x01FF; 1980 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['name'] = RGADnameLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['name']); 1981 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['originator'] = RGADoriginatorLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['originator']); 1982 $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['gain_db'] = RGADadjustmentLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['gain_adjust'], $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['sign_bit']); 1983 1984 if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] !== false) { 1985 $ThisFileInfo['replay_gain']['audiophile']['peak'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude']; 1986 } 1987 $ThisFileInfo['replay_gain']['audiophile']['originator'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['originator']; 1988 $ThisFileInfo['replay_gain']['audiophile']['adjustment'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['gain_db']; 1989 } 1990 1991 1992 // byte $AF Encoding flags + ATH Type 1993 $EncodingFlagsATHtype = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAF, 1)); 1994 $ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nspsytune'] = (bool) ($EncodingFlagsATHtype & 0x10); 1995 $ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nssafejoint'] = (bool) ($EncodingFlagsATHtype & 0x20); 1996 $ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nogap_next'] = (bool) ($EncodingFlagsATHtype & 0x40); 1997 $ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nogap_prev'] = (bool) ($EncodingFlagsATHtype & 0x80); 1998 $ThisFileInfo['mpeg']['audio']['LAME']['ath_type'] = $EncodingFlagsATHtype & 0x0F; 1999 2000 // byte $B0 if ABR {specified bitrate} else {minimal bitrate} 2001 $ABRbitrateMinBitrate = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB0, 1)); 2002 if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] == 2) { // Average BitRate (ABR) 2003 $ThisFileInfo['mpeg']['audio']['LAME']['bitrate_abr'] = $ABRbitrateMinBitrate; 2004 } elseif ($ABRbitrateMinBitrate > 0) { // Variable BitRate (VBR) - minimum bitrate 2005 $ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'] = $ABRbitrateMinBitrate; 2006 } 2007 2008 // bytes $B1-$B3 Encoder delays 2009 $EncoderDelays = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB1, 3)); 2010 $ThisFileInfo['mpeg']['audio']['LAME']['encoder_delay'] = ($EncoderDelays & 0xFFF000) >> 12; 2011 $ThisFileInfo['mpeg']['audio']['LAME']['end_padding'] = $EncoderDelays & 0x000FFF; 2012 2013 // byte $B4 Misc 2014 $MiscByte = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB4, 1)); 2015 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['noise_shaping'] = ($MiscByte & 0x03); 2016 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['stereo_mode'] = ($MiscByte & 0x1C) >> 2; 2017 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['not_optimal_quality'] = ($MiscByte & 0x20) >> 5; 2018 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['source_sample_freq'] = ($MiscByte & 0xC0) >> 6; 2019 $ThisFileInfo['mpeg']['audio']['LAME']['noise_shaping'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['noise_shaping']; 2020 $ThisFileInfo['mpeg']['audio']['LAME']['stereo_mode'] = LAMEmiscStereoModeLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['stereo_mode']); 2021 $ThisFileInfo['mpeg']['audio']['LAME']['not_optimal_quality'] = (bool) $ThisFileInfo['mpeg']['audio']['LAME']['raw']['not_optimal_quality']; 2022 $ThisFileInfo['mpeg']['audio']['LAME']['source_sample_freq'] = LAMEmiscSourceSampleFrequencyLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['source_sample_freq']); 2023 2024 // byte $B5 MP3 Gain 2025 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['mp3_gain'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB5, 1), false, true); 2026 $ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_db'] = 1.5 * $ThisFileInfo['mpeg']['audio']['LAME']['raw']['mp3_gain']; 2027 $ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_factor'] = pow(2, ($ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_db'] / 6)); 2028 2029 // bytes $B6-$B7 Preset and surround info 2030 $PresetSurroundBytes = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB6, 2)); 2031 // Reserved = ($PresetSurroundBytes & 0xC000); 2032 $ThisFileInfo['mpeg']['audio']['LAME']['raw']['surround_info'] = ($PresetSurroundBytes & 0x3800); 2033 $ThisFileInfo['mpeg']['audio']['LAME']['surround_info'] = LAMEsurroundInfoLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['surround_info']); 2034 $ThisFileInfo['mpeg']['audio']['LAME']['preset_used_id'] = ($PresetSurroundBytes & 0x07FF); 2035 2036 // bytes $B8-$BB MusicLength 2037 $ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB8, 4)); 2038 $ExpectedNumberOfAudioBytes = (($ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] > 0) ? $ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] : $ThisFileInfo['mpeg']['audio']['VBR_bytes']); 2039 2040 // bytes $BC-$BD MusicCRC 2041 $ThisFileInfo['mpeg']['audio']['LAME']['music_crc'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xBC, 2)); 2042 2043 // bytes $BE-$BF CRC-16 of Info Tag 2044 $ThisFileInfo['mpeg']['audio']['LAME']['lame_tag_crc'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xBE, 2)); 2045 2046 2047 // LAME CBR 2048 if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] == 1) { 2049 2050 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr'; 2051 if (empty($ThisFileInfo['mpeg']['audio']['bitrate']) || ($ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'] != 255)) { 2052 $ThisFileInfo['mpeg']['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min']; 2053 } 2054 2055 } 2056 2057 } 2058 } 2059 2060 } else { 2061 2062 // not Fraunhofer or Xing VBR methods, most likely CBR (but could be VBR with no header) 2063 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr'; 2064 if ($recursivesearch) { 2065 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr'; 2066 if (RecursiveFrameScanning($fd, $ThisFileInfo, $offset, $nextframetestoffset, true)) { 2067 $recursivesearch = false; 2068 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr'; 2069 } 2070 if ($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') { 2071 $ThisFileInfo['warning'] .= "\n".'VBR file with no VBR header. Bitrate values calculated from actual frame bitrates.'; 2072 } 2073 } 2074 2075 } 2076 2077 } 2078 2079 if (($ExpectedNumberOfAudioBytes > 0) && ($ExpectedNumberOfAudioBytes != ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']))) { 2080 if (($ExpectedNumberOfAudioBytes - ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])) == 1) { 2081 $ThisFileInfo['warning'] .= "\n".'Last byte of data truncated (this is a known bug in Meracl ID3 Tag Writer before v1.3.5)'; 2082 } elseif ($ExpectedNumberOfAudioBytes > ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])) { 2083 $ThisFileInfo['warning'] .= "\n".'Probable truncated file: expecting '.$ExpectedNumberOfAudioBytes.' bytes of audio data, only found '.($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']).' (short by '.($ExpectedNumberOfAudioBytes - ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])).' bytes)'; 2084 } else { 2085 $ThisFileInfo['warning'] .= "\n".'Too much data in file: expecting '.$ExpectedNumberOfAudioBytes.' bytes of audio data, found '.($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']).' ('.(($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']) - $ExpectedNumberOfAudioBytes).' bytes too many)'; 2086 } 2087 } 2088 2089 if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && empty($ThisFileInfo['audio']['bitrate'])) { 2090 if (($offset == $ThisFileInfo['avdataoffset']) && empty($ThisFileInfo['mpeg']['audio']['VBR_frames'])) { 2091 $framebytelength = FreeFormatFrameLength($fd, $offset, $ThisFileInfo, true); 2092 if ($framebytelength > 0) { 2093 $ThisFileInfo['mpeg']['audio']['framelength'] = $framebytelength; 2094 if ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') { 2095 // BitRate = (((FrameLengthInBytes / 4) - Padding) * SampleRate) / 12 2096 $ThisFileInfo['audio']['bitrate'] = ((($framebytelength / 4) - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 12; 2097 } else { 2098 // Bitrate = ((FrameLengthInBytes - Padding) * SampleRate) / 144 2099 $ThisFileInfo['audio']['bitrate'] = (($framebytelength - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 144; 2100 } 2101 } else { 2102 $ThisFileInfo['error'] .= "\n".'Error calculating frame length of free-format MP3 without Xing/LAME header'; 2103 } 2104 } 2105 } 2106 2107 if (($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') && isset($ThisFileInfo['mpeg']['audio']['VBR_frames']) && ($ThisFileInfo['mpeg']['audio']['VBR_frames'] > 1)) { 2108 $ThisFileInfo['mpeg']['audio']['VBR_frames']--; // don't count the Xing / VBRI frame 2109 if (($ThisFileInfo['mpeg']['audio']['version'] == '1') && ($ThisFileInfo['mpeg']['audio']['layer'] == 'I')) { 2110 $ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 384)) / 1000; 2111 } elseif ((($ThisFileInfo['mpeg']['audio']['version'] == '2') || ($ThisFileInfo['mpeg']['audio']['version'] == '2.5')) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'III')) { 2112 $ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 576)) / 1000; 2113 } else { 2114 $ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 1152)) / 1000; 2115 } 2116 if ($ThisFileInfo['mpeg']['audio']['VBR_bitrate'] > 0) { 2117 $ThisFileInfo['audio']['bitrate'] = 1000 * $ThisFileInfo['mpeg']['audio']['VBR_bitrate']; 2118 $ThisFileInfo['mpeg']['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['VBR_bitrate']; // to avoid confusion 2119 } 2120 } 2121 2122 // End variable-bitrate headers 2123 //////////////////////////////////////////////////////////////////////////////////// 2124 2125 if ($recursivesearch) { 2126 2127 if (!RecursiveFrameScanning($fd, $ThisFileInfo, $offset, $nextframetestoffset, $ScanAsCBR)) { 2128 return false; 2129 } 2130 2131 } 2132 2133 2134 //if (false) { 2135 // // experimental side info parsing section - not returning anything useful yet 2136 // 2137 // $SideInfoBitstream = BigEndian2Bin($SideInfoData); 2138 // $SideInfoOffset = 0; 2139 // 2140 // if ($ThisFileInfo['mpeg']['audio']['version'] == '1') { 2141 // if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') { 2142 // // MPEG-1 (mono) 2143 // $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 9); 2144 // $SideInfoOffset += 9; 2145 // $SideInfoOffset += 5; 2146 // } else { 2147 // // MPEG-1 (stereo, joint-stereo, dual-channel) 2148 // $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 9); 2149 // $SideInfoOffset += 9; 2150 // $SideInfoOffset += 3; 2151 // } 2152 // } else { // 2 or 2.5 2153 // if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') { 2154 // // MPEG-2, MPEG-2.5 (mono) 2155 // $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 8); 2156 // $SideInfoOffset += 8; 2157 // $SideInfoOffset += 1; 2158 // } else { 2159 // // MPEG-2, MPEG-2.5 (stereo, joint-stereo, dual-channel) 2160 // $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 8); 2161 // $SideInfoOffset += 8; 2162 // $SideInfoOffset += 2; 2163 // } 2164 // } 2165 // 2166 // if ($ThisFileInfo['mpeg']['audio']['version'] == '1') { 2167 // for ($channel = 0; $channel < $ThisFileInfo['audio']['channels']; $channel++) { 2168 // for ($scfsi_band = 0; $scfsi_band < 4; $scfsi_band++) { 2169 // $ThisFileInfo['mpeg']['audio']['scfsi'][$channel][$scfsi_band] = substr($SideInfoBitstream, $SideInfoOffset, 1); 2170 // $SideInfoOffset += 2; 2171 // } 2172 // } 2173 // } 2174 // for ($granule = 0; $granule < (($ThisFileInfo['mpeg']['audio']['version'] == '1') ? 2 : 1); $granule++) { 2175 // for ($channel = 0; $channel < $ThisFileInfo['audio']['channels']; $channel++) { 2176 // $ThisFileInfo['mpeg']['audio']['part2_3_length'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 12); 2177 // $SideInfoOffset += 12; 2178 // $ThisFileInfo['mpeg']['audio']['big_values'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 9); 2179 // $SideInfoOffset += 9; 2180 // $ThisFileInfo['mpeg']['audio']['global_gain'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 8); 2181 // $SideInfoOffset += 8; 2182 // if ($ThisFileInfo['mpeg']['audio']['version'] == '1') { 2183 // $ThisFileInfo['mpeg']['audio']['scalefac_compress'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 4); 2184 // $SideInfoOffset += 4; 2185 // } else { 2186 // $ThisFileInfo['mpeg']['audio']['scalefac_compress'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 9); 2187 // $SideInfoOffset += 9; 2188 // } 2189 // $ThisFileInfo['mpeg']['audio']['window_switching_flag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1); 2190 // $SideInfoOffset += 1; 2191 // 2192 // if ($ThisFileInfo['mpeg']['audio']['window_switching_flag'][$granule][$channel] == '1') { 2193 // 2194 // $ThisFileInfo['mpeg']['audio']['block_type'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 2); 2195 // $SideInfoOffset += 2; 2196 // $ThisFileInfo['mpeg']['audio']['mixed_block_flag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1); 2197 // $SideInfoOffset += 1; 2198 // 2199 // for ($region = 0; $region < 2; $region++) { 2200 // $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][$region] = substr($SideInfoBitstream, $SideInfoOffset, 5); 2201 // $SideInfoOffset += 5; 2202 // } 2203 // $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][2] = 0; 2204 // 2205 // for ($window = 0; $window < 3; $window++) { 2206 // $ThisFileInfo['mpeg']['audio']['subblock_gain'][$granule][$channel][$window] = substr($SideInfoBitstream, $SideInfoOffset, 3); 2207 // $SideInfoOffset += 3; 2208 // } 2209 // 2210 // } else { 2211 // 2212 // for ($region = 0; $region < 3; $region++) { 2213 // $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][$region] = substr($SideInfoBitstream, $SideInfoOffset, 5); 2214 // $SideInfoOffset += 5; 2215 // } 2216 // 2217 // $ThisFileInfo['mpeg']['audio']['region0_count'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 4); 2218 // $SideInfoOffset += 4; 2219 // $ThisFileInfo['mpeg']['audio']['region1_count'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 3); 2220 // $SideInfoOffset += 3; 2221 // $ThisFileInfo['mpeg']['audio']['block_type'][$granule][$channel] = 0; 2222 // } 2223 // 2224 // if ($ThisFileInfo['mpeg']['audio']['version'] == '1') { 2225 // $ThisFileInfo['mpeg']['audio']['preflag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1); 2226 // $SideInfoOffset += 1; 2227 // } 2228 // $ThisFileInfo['mpeg']['audio']['scalefac_scale'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1); 2229 // $SideInfoOffset += 1; 2230 // $ThisFileInfo['mpeg']['audio']['count1table_select'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1); 2231 // $SideInfoOffset += 1; 2232 // } 2233 // } 2234 //} 2235 2236 return true; 2237} 2238 2239function RecursiveFrameScanning(&$fd, &$ThisFileInfo, &$offset, &$nextframetestoffset, $ScanAsCBR) { 2240 for ($i = 0; $i < MPEG_VALID_CHECK_FRAMES; $i++) { 2241 // check next MPEG_VALID_CHECK_FRAMES frames for validity, to make sure we haven't run across a false synch 2242 if (($nextframetestoffset + 4) >= $ThisFileInfo['avdataend']) { 2243 // end of file 2244 return true; 2245 } 2246 2247 $nextframetestarray = array('error'=>'', 'warning'=>'', 'avdataend'=>$ThisFileInfo['avdataend'], 'avdataoffset'=>$ThisFileInfo['avdataoffset']); 2248 if (decodeMPEGaudioHeader($fd, $nextframetestoffset, $nextframetestarray, false)) { 2249 if ($ScanAsCBR) { 2250 // force CBR mode, used for trying to pick out invalid audio streams with 2251 // valid(?) VBR headers, or VBR streams with no VBR header 2252 if (!isset($nextframetestarray['mpeg']['audio']['bitrate']) || !isset($ThisFileInfo['mpeg']['audio']['bitrate']) || ($nextframetestarray['mpeg']['audio']['bitrate'] != $ThisFileInfo['mpeg']['audio']['bitrate'])) { 2253 return false; 2254 } 2255 } 2256 2257 2258 // next frame is OK, get ready to check the one after that 2259 if (isset($nextframetestarray['mpeg']['audio']['framelength']) && ($nextframetestarray['mpeg']['audio']['framelength'] > 0)) { 2260 $nextframetestoffset += $nextframetestarray['mpeg']['audio']['framelength']; 2261 } else { 2262 $ThisFileInfo['error'] .= "\n".'Frame at offset ('.$offset.') is has an invalid frame length.'; 2263 return false; 2264 } 2265 2266 } else { 2267 2268 // next frame is not valid, note the error and fail, so scanning can contiue for a valid frame sequence 2269 $ThisFileInfo['error'] .= "\n".'Frame at offset ('.$offset.') is valid, but the next one at ('.$nextframetestoffset.') is not.'; 2270 2271 return false; 2272 } 2273 } 2274 return true; 2275} 2276 2277function FreeFormatFrameLength($fd, $offset, &$ThisFileInfo, $deepscan=false) { 2278 fseek($fd, $offset, SEEK_SET); 2279 $MPEGaudioData = fread($fd, 32768); 2280 2281 $SyncPattern1 = substr($MPEGaudioData, 0, 4); 2282 // may be different pattern due to padding 2283 $SyncPattern2 = $SyncPattern1[0].$SyncPattern1[1].chr(ord($SyncPattern1[2]) | 0x02).$SyncPattern1[3]; 2284 if ($SyncPattern2 === $SyncPattern1) { 2285 $SyncPattern2 = $SyncPattern1[0].$SyncPattern1[1].chr(ord($SyncPattern1[2]) & 0xFD).$SyncPattern1[3]; 2286 } 2287 2288 $framelength = false; 2289 $framelength1 = strpos($MPEGaudioData, $SyncPattern1, 4); 2290 $framelength2 = strpos($MPEGaudioData, $SyncPattern2, 4); 2291 if ($framelength1 > 4) { 2292 $framelength = $framelength1; 2293 } 2294 if (($framelength2 > 4) && ($framelength2 < $framelength1)) { 2295 $framelength = $framelength2; 2296 } 2297 if (!$framelength) { 2298 2299 // LAME 3.88 has a different value for modeextension on the first frame vs the rest 2300 $framelength1 = strpos($MPEGaudioData, substr($SyncPattern1, 0, 3), 4); 2301 $framelength2 = strpos($MPEGaudioData, substr($SyncPattern2, 0, 3), 4); 2302 2303 if ($framelength1 > 4) { 2304 $framelength = $framelength1; 2305 } 2306 if (($framelength2 > 4) && ($framelength2 < $framelength1)) { 2307 $framelength = $framelength2; 2308 } 2309 if (!$framelength) { 2310 $ThisFileInfo['error'] .= "\n".'Cannot find next free-format synch pattern ('.PrintHexBytes($SyncPattern1).' or '.PrintHexBytes($SyncPattern2).') after offset '.$offset; 2311 return false; 2312 } else { 2313 $ThisFileInfo['warning'] .= "\n".'ModeExtension varies between first frame and other frames (known free-format issue in LAME 3.88)'; 2314 $ThisFileInfo['audio']['codec'] = 'LAME'; 2315 $ThisFileInfo['audio']['encoder'] = 'LAME3.88'; 2316 $SyncPattern1 = substr($SyncPattern1, 0, 3); 2317 $SyncPattern2 = substr($SyncPattern2, 0, 3); 2318 } 2319 } 2320 2321 if ($deepscan) { 2322 2323 $ActualFrameLengthValues = array(); 2324 $nextoffset = $offset + $framelength; 2325 while ($nextoffset < ($ThisFileInfo['avdataend'] - 6)) { 2326 fseek($fd, $nextoffset - 1, SEEK_SET); 2327 $NextSyncPattern = fread($fd, 6); 2328 if ((substr($NextSyncPattern, 1, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 1, strlen($SyncPattern2)) == $SyncPattern2)) { 2329 // good - found where expected 2330 $ActualFrameLengthValues[] = $framelength; 2331 } elseif ((substr($NextSyncPattern, 0, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 0, strlen($SyncPattern2)) == $SyncPattern2)) { 2332 // ok - found one byte earlier than expected (last frame wasn't padded, first frame was) 2333 $ActualFrameLengthValues[] = ($framelength - 1); 2334 $nextoffset--; 2335 } elseif ((substr($NextSyncPattern, 2, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 2, strlen($SyncPattern2)) == $SyncPattern2)) { 2336 // ok - found one byte later than expected (last frame was padded, first frame wasn't) 2337 $ActualFrameLengthValues[] = ($framelength + 1); 2338 $nextoffset++; 2339 } else { 2340 $ThisFileInfo['error'] .= "\n".'Did not find expected free-format sync pattern at offset '.$nextoffset; 2341 return false; 2342 } 2343 $nextoffset += $framelength; 2344 } 2345 if (count($ActualFrameLengthValues) > 0) { 2346 $framelength = round(array_sum($ActualFrameLengthValues) / count($ActualFrameLengthValues)); 2347 } 2348 } 2349 return $framelength; 2350} 2351 2352 2353function getOnlyMPEGaudioInfo($fd, &$ThisFileInfo, $avdataoffset, $BitrateHistogram=false) { 2354 // looks for synch, decodes MPEG audio header 2355 2356 fseek($fd, $avdataoffset, SEEK_SET); 2357 $header = ''; 2358 $SynchSeekOffset = 0; 2359 2360 if (!defined('CONST_FF')) { 2361 define('CONST_FF', chr(0xFF)); 2362 define('CONST_E0', chr(0xE0)); 2363 } 2364 2365 static $MPEGaudioVersionLookup; 2366 static $MPEGaudioLayerLookup; 2367 static $MPEGaudioBitrateLookup; 2368 if (empty($MPEGaudioVersionLookup)) { 2369 $MPEGaudioVersionLookup = MPEGaudioVersionArray(); 2370 $MPEGaudioLayerLookup = MPEGaudioLayerArray(); 2371 $MPEGaudioBitrateLookup = MPEGaudioBitrateArray(); 2372 2373 } 2374 2375 $header_len = strlen($header) - round(32768 / 2); 2376 while (true) { 2377 2378 if (($SynchSeekOffset > $header_len) && (($avdataoffset + $SynchSeekOffset) < $ThisFileInfo['avdataend']) && !feof($fd)) { 2379 2380 if ($SynchSeekOffset > 131072) { 2381 // if a synch's not found within the first 128k bytes, then give up 2382 $ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch within the first 131072 bytes'; 2383 if (isset($ThisFileInfo['audio']['bitrate'])) { 2384 unset($ThisFileInfo['audio']['bitrate']); 2385 } 2386 if (isset($ThisFileInfo['mpeg']['audio'])) { 2387 unset($ThisFileInfo['mpeg']['audio']); 2388 } 2389 if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || (count($ThisFileInfo['mpeg']) == 0))) { 2390 unset($ThisFileInfo['mpeg']); 2391 } 2392 return false; 2393 2394 } elseif ($header .= fread($fd, 32768)) { 2395 2396 // great 2397 $header_len = strlen($header) - round(32768 / 2); 2398 2399 } else { 2400 2401 $ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file'; 2402 if (isset($ThisFileInfo['audio']['bitrate'])) { 2403 unset($ThisFileInfo['audio']['bitrate']); 2404 } 2405 if (isset($ThisFileInfo['mpeg']['audio'])) { 2406 unset($ThisFileInfo['mpeg']['audio']); 2407 } 2408 if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || (count($ThisFileInfo['mpeg']) == 0))) { 2409 unset($ThisFileInfo['mpeg']); 2410 } 2411 return false; 2412 2413 } 2414 } 2415 2416 if (($SynchSeekOffset + 1) >= strlen($header)) { 2417 $ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file'; 2418 return false; 2419 } 2420 2421 if (($header[$SynchSeekOffset] == CONST_FF) && ($header[($SynchSeekOffset + 1)] > CONST_E0)) { // synch detected 2422 2423 if (!isset($FirstFrameThisfileInfo) && !isset($ThisFileInfo['mpeg']['audio'])) { 2424 $FirstFrameThisfileInfo = $ThisFileInfo; 2425 $FirstFrameAVDataOffset = $avdataoffset + $SynchSeekOffset; 2426 if (!decodeMPEGaudioHeader($fd, $avdataoffset + $SynchSeekOffset, $FirstFrameThisfileInfo, false)) { 2427 // if this is the first valid MPEG-audio frame, save it in case it's a VBR header frame and there's 2428 // garbage between this frame and a valid sequence of MPEG-audio frames, to be restored below 2429 unset($FirstFrameThisfileInfo); 2430 } 2431 } 2432 $dummy = $ThisFileInfo; // only overwrite real data if valid header found 2433 2434 if (decodeMPEGaudioHeader($fd, $avdataoffset + $SynchSeekOffset, $dummy, true)) { 2435 2436 $ThisFileInfo = $dummy; 2437 $ThisFileInfo['avdataoffset'] = $avdataoffset + $SynchSeekOffset; 2438 switch ($ThisFileInfo['fileformat']) { 2439 case '': 2440 case 'id3': 2441 case 'ape': 2442 case 'mp3': 2443 $ThisFileInfo['fileformat'] = 'mp3'; 2444 $ThisFileInfo['audio']['dataformat'] = 'mp3'; 2445 } 2446 if (isset($FirstFrameThisfileInfo['mpeg']['audio']['bitrate_mode']) && ($FirstFrameThisfileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr')) { 2447 if (!CloseMatch($ThisFileInfo['audio']['bitrate'], $FirstFrameThisfileInfo['audio']['bitrate'], 1)) { 2448 // If there is garbage data between a valid VBR header frame and a sequence 2449 // of valid MPEG-audio frames the VBR data is no longer discarded. 2450 $ThisFileInfo = $FirstFrameThisfileInfo; 2451 $ThisFileInfo['avdataoffset'] = $FirstFrameAVDataOffset; 2452 $ThisFileInfo['fileformat'] = 'mp3'; 2453 $ThisFileInfo['audio']['dataformat'] = 'mp3'; 2454 $dummy = $ThisFileInfo; 2455 unset($dummy['mpeg']['audio']); 2456 $GarbageOffsetStart = $FirstFrameAVDataOffset + $FirstFrameThisfileInfo['mpeg']['audio']['framelength']; 2457 $GarbageOffsetEnd = $avdataoffset + $SynchSeekOffset; 2458 if (decodeMPEGaudioHeader($fd, $GarbageOffsetEnd, $dummy, true, true)) { 2459 2460 $ThisFileInfo = $dummy; 2461 $ThisFileInfo['avdataoffset'] = $GarbageOffsetEnd; 2462 $ThisFileInfo['warning'] .= "\n".'apparently-valid VBR header not used because could not find '.MPEG_VALID_CHECK_FRAMES.' consecutive MPEG-audio frames immediately after VBR header (garbage data for '.($GarbageOffsetEnd - $GarbageOffsetStart).' bytes between '.$GarbageOffsetStart.' and '.$GarbageOffsetEnd.'), but did find valid CBR stream starting at '.$GarbageOffsetEnd; 2463 2464 } else { 2465 2466 $ThisFileInfo['warning'] .= "\n".'using data from VBR header even though could not find '.MPEG_VALID_CHECK_FRAMES.' consecutive MPEG-audio frames immediately after VBR header (garbage data for '.($GarbageOffsetEnd - $GarbageOffsetStart).' bytes between '.$GarbageOffsetStart.' and '.$GarbageOffsetEnd.')'; 2467 2468 } 2469 } 2470 } 2471 2472 if (isset($ThisFileInfo['mpeg']['audio']['bitrate_mode']) && ($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') && !isset($ThisFileInfo['mpeg']['audio']['VBR_method'])) { 2473 // VBR file with no VBR header 2474 $BitrateHistogram = true; 2475 } 2476 2477 if ($BitrateHistogram) { 2478 2479 $ThisFileInfo['mpeg']['audio']['stereo_distribution'] = array('stereo'=>0, 'joint stereo'=>0, 'dual channel'=>0, 'mono'=>0); 2480 $ThisFileInfo['mpeg']['audio']['version_distribution'] = array('1'=>0, '2'=>0, '2.5'=>0); 2481 2482 if ($ThisFileInfo['mpeg']['audio']['version'] == '1') { 2483 if ($ThisFileInfo['mpeg']['audio']['layer'] == 'III') { 2484 $ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 40=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 320=>0); 2485 } elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'II') { 2486 $ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 320=>0, 384=>0); 2487 } elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') { 2488 $ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 64=>0, 96=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 288=>0, 320=>0, 352=>0, 384=>0, 416=>0, 448=>0); 2489 } 2490 } elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') { 2491 $ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 144=>0, 160=>0, 176=>0, 192=>0, 224=>0, 256=>0); 2492 } else { 2493 $ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 8=>0, 16=>0, 24=>0, 32=>0, 40=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 144=>0, 160=>0); 2494 } 2495 2496 $dummy = array('error'=>$ThisFileInfo['error'], 'warning'=>$ThisFileInfo['warning'], 'avdataend'=>$ThisFileInfo['avdataend'], 'avdataoffset'=>$ThisFileInfo['avdataoffset']); 2497 $synchstartoffset = $ThisFileInfo['avdataoffset']; 2498 2499 $FastMode = false; 2500 while (decodeMPEGaudioHeader($fd, $synchstartoffset, $dummy, false, false, $FastMode)) { 2501 $FastMode = true; 2502 $thisframebitrate = $MPEGaudioBitrateLookup[$MPEGaudioVersionLookup[$dummy['mpeg']['audio']['raw']['version']]][$MPEGaudioLayerLookup[$dummy['mpeg']['audio']['raw']['layer']]][$dummy['mpeg']['audio']['raw']['bitrate']]; 2503 2504 $ThisFileInfo['mpeg']['audio']['bitrate_distribution'][$thisframebitrate]++; 2505 $ThisFileInfo['mpeg']['audio']['stereo_distribution'][$dummy['mpeg']['audio']['channelmode']]++; 2506 $ThisFileInfo['mpeg']['audio']['version_distribution'][$dummy['mpeg']['audio']['version']]++; 2507 if (empty($dummy['mpeg']['audio']['framelength'])) { 2508 $ThisFileInfo['warning'] .= "\n".'Invalid/missing framelength in histogram analysis - aborting'; 2509$synchstartoffset += 4; 2510// return false; 2511 } 2512 $synchstartoffset += $dummy['mpeg']['audio']['framelength']; 2513 } 2514 2515 $bittotal = 0; 2516 $framecounter = 0; 2517 foreach ($ThisFileInfo['mpeg']['audio']['bitrate_distribution'] as $bitratevalue => $bitratecount) { 2518 $framecounter += $bitratecount; 2519 if ($bitratevalue != 'free') { 2520 $bittotal += ($bitratevalue * $bitratecount); 2521 } 2522 } 2523 if ($framecounter == 0) { 2524 $ThisFileInfo['error'] .= "\n".'Corrupt MP3 file: framecounter == zero'; 2525 return false; 2526 } 2527 $ThisFileInfo['mpeg']['audio']['frame_count'] = $framecounter; 2528 $ThisFileInfo['mpeg']['audio']['bitrate'] = 1000 * ($bittotal / $framecounter); 2529 2530 $ThisFileInfo['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['bitrate']; 2531 2532 2533 // Definitively set VBR vs CBR, even if the Xing/LAME/VBRI header says differently 2534 $distinct_bitrates = 0; 2535 foreach ($ThisFileInfo['mpeg']['audio']['bitrate_distribution'] as $bitrate_value => $bitrate_count) { 2536 if ($bitrate_count > 0) { 2537 $distinct_bitrates++; 2538 } 2539 } 2540 if ($distinct_bitrates > 1) { 2541 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr'; 2542 } else { 2543 $ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr'; 2544 } 2545 $ThisFileInfo['audio']['bitrate_mode'] = $ThisFileInfo['mpeg']['audio']['bitrate_mode']; 2546 2547 } 2548 2549 break; // exit while() 2550 } 2551 } 2552 2553 $SynchSeekOffset++; 2554 if (($avdataoffset + $SynchSeekOffset) >= $ThisFileInfo['avdataend']) { 2555 // end of file/data 2556 2557 if (empty($ThisFileInfo['mpeg']['audio'])) { 2558 2559 $ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file'; 2560 if (isset($ThisFileInfo['audio']['bitrate'])) { 2561 unset($ThisFileInfo['audio']['bitrate']); 2562 } 2563 if (isset($ThisFileInfo['mpeg']['audio'])) { 2564 unset($ThisFileInfo['mpeg']['audio']); 2565 } 2566 if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || empty($ThisFileInfo['mpeg']))) { 2567 unset($ThisFileInfo['mpeg']); 2568 } 2569 return false; 2570 2571 } 2572 break; 2573 } 2574 2575 } 2576 $ThisFileInfo['audio']['bits_per_sample'] = 16; 2577 $ThisFileInfo['audio']['channels'] = $ThisFileInfo['mpeg']['audio']['channels']; 2578 $ThisFileInfo['audio']['channelmode'] = $ThisFileInfo['mpeg']['audio']['channelmode']; 2579 $ThisFileInfo['audio']['sample_rate'] = $ThisFileInfo['mpeg']['audio']['sample_rate']; 2580 return true; 2581} 2582 2583 2584function MPEGaudioVersionArray() { 2585 static $MPEGaudioVersion = array('2.5', false, '2', '1'); 2586 return $MPEGaudioVersion; 2587} 2588 2589function MPEGaudioLayerArray() { 2590 static $MPEGaudioLayer = array(false, 'III', 'II', 'I'); 2591 return $MPEGaudioLayer; 2592} 2593 2594function MPEGaudioBitrateArray() { 2595 static $MPEGaudioBitrate; 2596 if (empty($MPEGaudioBitrate)) { 2597 $MPEGaudioBitrate['1']['I'] = array('free', 32, 64, 96, 128, 160, 192, 224, 256, 288, 320, 352, 384, 416, 448); 2598 $MPEGaudioBitrate['1']['II'] = array('free', 32, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 256, 320, 384); 2599 $MPEGaudioBitrate['1']['III'] = array('free', 32, 40, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 256, 320); 2600 $MPEGaudioBitrate['2']['I'] = array('free', 32, 48, 56, 64, 80, 96, 112, 128, 144, 160, 176, 192, 224, 256); 2601 $MPEGaudioBitrate['2']['II'] = array('free', 8, 16, 24, 32, 40, 48, 56, 64, 80, 96, 112, 128, 144, 160); 2602 $MPEGaudioBitrate['2']['III'] = $MPEGaudioBitrate['2']['II']; 2603 $MPEGaudioBitrate['2.5']['I'] = $MPEGaudioBitrate['2']['I']; 2604 $MPEGaudioBitrate['2.5']['II'] = $MPEGaudioBitrate['2']['II']; 2605 $MPEGaudioBitrate['2.5']['III'] = $MPEGaudioBitrate['2']['III']; 2606 } 2607 return $MPEGaudioBitrate; 2608} 2609 2610function MPEGaudioFrequencyArray() { 2611 static $MPEGaudioFrequency; 2612 if (empty($MPEGaudioFrequency)) { 2613 $MPEGaudioFrequency['1'] = array(44100, 48000, 32000); 2614 $MPEGaudioFrequency['2'] = array(22050, 24000, 16000); 2615 $MPEGaudioFrequency['2.5'] = array(11025, 12000, 8000); 2616 } 2617 return $MPEGaudioFrequency; 2618} 2619 2620function MPEGaudioChannelModeArray() { 2621 static $MPEGaudioChannelMode = array('stereo', 'joint stereo', 'dual channel', 'mono'); 2622 return $MPEGaudioChannelMode; 2623} 2624 2625function MPEGaudioModeExtensionArray() { 2626 static $MPEGaudioModeExtension; 2627 if (empty($MPEGaudioModeExtension)) { 2628 $MPEGaudioModeExtension['I'] = array('4-31', '8-31', '12-31', '16-31'); 2629 $MPEGaudioModeExtension['II'] = array('4-31', '8-31', '12-31', '16-31'); 2630 $MPEGaudioModeExtension['III'] = array('', 'IS', 'MS', 'IS+MS'); 2631 } 2632 return $MPEGaudioModeExtension; 2633} 2634 2635function MPEGaudioEmphasisArray() { 2636 static $MPEGaudioEmphasis = array('none', '50/15ms', false, 'CCIT J.17'); 2637 return $MPEGaudioEmphasis; 2638} 2639 2640 2641function MPEGaudioHeaderBytesValid($head4) { 2642 return MPEGaudioHeaderValid(MPEGaudioHeaderDecode($head4)); 2643} 2644 2645function MPEGaudioHeaderValid($rawarray, $echoerrors=false) { 2646 2647 if (($rawarray['synch'] & 0x0FFE) != 0x0FFE) { 2648 return false; 2649 } 2650 2651 static $MPEGaudioVersionLookup; 2652 static $MPEGaudioLayerLookup; 2653 static $MPEGaudioBitrateLookup; 2654 static $MPEGaudioFrequencyLookup; 2655 static $MPEGaudioChannelModeLookup; 2656 static $MPEGaudioModeExtensionLookup; 2657 static $MPEGaudioEmphasisLookup; 2658 if (empty($MPEGaudioVersionLookup)) { 2659 $MPEGaudioVersionLookup = MPEGaudioVersionArray(); 2660 $MPEGaudioLayerLookup = MPEGaudioLayerArray(); 2661 $MPEGaudioBitrateLookup = MPEGaudioBitrateArray(); 2662 $MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray(); 2663 $MPEGaudioChannelModeLookup = MPEGaudioChannelModeArray(); 2664 $MPEGaudioModeExtensionLookup = MPEGaudioModeExtensionArray(); 2665 $MPEGaudioEmphasisLookup = MPEGaudioEmphasisArray(); 2666 } 2667 2668 if (isset($MPEGaudioVersionLookup[$rawarray['version']])) { 2669 $decodedVersion = $MPEGaudioVersionLookup[$rawarray['version']]; 2670 } else { 2671 if ($echoerrors) { 2672 echo "\n".'invalid Version ('.$rawarray['version'].')'; 2673 } 2674 return false; 2675 } 2676 if (isset($MPEGaudioLayerLookup[$rawarray['layer']])) { 2677 $decodedLayer = $MPEGaudioLayerLookup[$rawarray['layer']]; 2678 } else { 2679 if ($echoerrors) { 2680 echo "\n".'invalid Layer ('.$rawarray['layer'].')'; 2681 } 2682 return false; 2683 } 2684 if (!isset($MPEGaudioBitrateLookup[$decodedVersion][$decodedLayer][$rawarray['bitrate']])) { 2685 if ($echoerrors) { 2686 echo "\n".'invalid Bitrate ('.$rawarray['bitrate'].')'; 2687 } 2688 if ($rawarray['bitrate'] == 15) { 2689 // known issue in LAME 3.90 - 3.93.1 where free-format has bitrate ID of 15 instead of 0 2690 // let it go through here otherwise file will not be identified 2691 } else { 2692 return false; 2693 } 2694 } 2695 if (!isset($MPEGaudioFrequencyLookup[$decodedVersion][$rawarray['sample_rate']])) { 2696 if ($echoerrors) { 2697 echo "\n".'invalid Frequency ('.$rawarray['sample_rate'].')'; 2698 } 2699 return false; 2700 } 2701 if (!isset($MPEGaudioChannelModeLookup[$rawarray['channelmode']])) { 2702 if ($echoerrors) { 2703 echo "\n".'invalid ChannelMode ('.$rawarray['channelmode'].')'; 2704 } 2705 return false; 2706 } 2707 if (!isset($MPEGaudioModeExtensionLookup[$decodedLayer][$rawarray['modeextension']])) { 2708 if ($echoerrors) { 2709 echo "\n".'invalid Mode Extension ('.$rawarray['modeextension'].')'; 2710 } 2711 return false; 2712 } 2713 if (!isset($MPEGaudioEmphasisLookup[$rawarray['emphasis']])) { 2714 if ($echoerrors) { 2715 echo "\n".'invalid Emphasis ('.$rawarray['emphasis'].')'; 2716 } 2717 return false; 2718 } 2719 // These are just either set or not set, you can't mess that up :) 2720 // $rawarray['protection']; 2721 // $rawarray['padding']; 2722 // $rawarray['private']; 2723 // $rawarray['copyright']; 2724 // $rawarray['original']; 2725 2726 return true; 2727} 2728 2729function MPEGaudioHeaderDecode($Header4Bytes) { 2730 // AAAA AAAA AAAB BCCD EEEE FFGH IIJJ KLMM 2731 // A - Frame sync (all bits set) 2732 // B - MPEG Audio version ID 2733 // C - Layer description 2734 // D - Protection bit 2735 // E - Bitrate index 2736 // F - Sampling rate frequency index 2737 // G - Padding bit 2738 // H - Private bit 2739 // I - Channel Mode 2740 // J - Mode extension (Only if Joint stereo) 2741 // K - Copyright 2742 // L - Original 2743 // M - Emphasis 2744 2745 if (strlen($Header4Bytes) != 4) { 2746 return false; 2747 } 2748 2749 $MPEGrawHeader['synch'] = (BigEndian2Int(substr($Header4Bytes, 0, 2)) & 0xFFE0) >> 4; 2750 $MPEGrawHeader['version'] = (ord($Header4Bytes[1]) & 0x18) >> 3; // BB 2751 $MPEGrawHeader['layer'] = (ord($Header4Bytes[1]) & 0x06) >> 1; // CC 2752 $MPEGrawHeader['protection'] = (ord($Header4Bytes[1]) & 0x01); // D 2753 $MPEGrawHeader['bitrate'] = (ord($Header4Bytes[2]) & 0xF0) >> 4; // EEEE 2754 $MPEGrawHeader['sample_rate'] = (ord($Header4Bytes[2]) & 0x0C) >> 2; // FF 2755 $MPEGrawHeader['padding'] = (ord($Header4Bytes[2]) & 0x02) >> 1; // G 2756 $MPEGrawHeader['private'] = (ord($Header4Bytes[2]) & 0x01); // H 2757 $MPEGrawHeader['channelmode'] = (ord($Header4Bytes[3]) & 0xC0) >> 6; // II 2758 $MPEGrawHeader['modeextension'] = (ord($Header4Bytes[3]) & 0x30) >> 4; // JJ 2759 $MPEGrawHeader['copyright'] = (ord($Header4Bytes[3]) & 0x08) >> 3; // K 2760 $MPEGrawHeader['original'] = (ord($Header4Bytes[3]) & 0x04) >> 2; // L 2761 $MPEGrawHeader['emphasis'] = (ord($Header4Bytes[3]) & 0x03); // MM 2762 2763 return $MPEGrawHeader; 2764} 2765 2766function MPEGaudioFrameLength(&$bitrate, &$version, &$layer, $padding, &$samplerate) { 2767 static $AudioFrameLengthCache = array(); 2768 2769 if (!isset($AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate])) { 2770 $AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate] = false; 2771 if ($bitrate != 'free') { 2772 2773 if ($version == '1') { 2774 2775 if ($layer == 'I') { 2776 2777 // For Layer I slot is 32 bits long 2778 $FrameLengthCoefficient = 48; 2779 $SlotLength = 4; 2780 2781 } else { // Layer II / III 2782 2783 // for Layer II and Layer III slot is 8 bits long. 2784 $FrameLengthCoefficient = 144; 2785 $SlotLength = 1; 2786 2787 } 2788 2789 } else { // MPEG-2 / MPEG-2.5 2790 2791 if ($layer == 'I') { 2792 2793 // For Layer I slot is 32 bits long 2794 $FrameLengthCoefficient = 24; 2795 $SlotLength = 4; 2796 2797 } elseif ($layer == 'II') { 2798 2799 // for Layer II and Layer III slot is 8 bits long. 2800 $FrameLengthCoefficient = 144; 2801 $SlotLength = 1; 2802 2803 } else { // III 2804 2805 // for Layer II and Layer III slot is 8 bits long. 2806 $FrameLengthCoefficient = 72; 2807 $SlotLength = 1; 2808 2809 } 2810 2811 } 2812 2813 // FrameLengthInBytes = ((Coefficient * BitRate) / SampleRate) + Padding 2814 // http://66.96.216.160/cgi-bin/YaBB.pl?board=c&action=display&num=1018474068 2815 // -> [Finding the next frame synch] on www.r3mix.net forums if the above link goes dead 2816 if ($samplerate > 0) { 2817 $NewFramelength = ($FrameLengthCoefficient * $bitrate * 1000) / $samplerate; 2818 $NewFramelength = floor($NewFramelength / $SlotLength) * $SlotLength; // round to next-lower multiple of SlotLength (1 byte for Layer II/III, 4 bytes for Layer I) 2819 if ($padding) { 2820 $NewFramelength += $SlotLength; 2821 } 2822 $AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate] = (int) $NewFramelength; 2823 } 2824 } 2825 } 2826 return $AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate]; 2827} 2828 2829function LAMEvbrMethodLookup($VBRmethodID) { 2830 static $LAMEvbrMethodLookup = array(); 2831 if (empty($LAMEvbrMethodLookup)) { 2832 $LAMEvbrMethodLookup[0x00] = 'unknown'; 2833 $LAMEvbrMethodLookup[0x01] = 'cbr'; 2834 $LAMEvbrMethodLookup[0x02] = 'abr'; 2835 $LAMEvbrMethodLookup[0x03] = 'vbr-old / vbr-rh'; 2836 $LAMEvbrMethodLookup[0x04] = 'vbr-mtrh'; 2837 $LAMEvbrMethodLookup[0x05] = 'vbr-new / vbr-mt'; 2838 } 2839 return (isset($LAMEvbrMethodLookup[$VBRmethodID]) ? $LAMEvbrMethodLookup[$VBRmethodID] : ''); 2840} 2841 2842function LAMEmiscStereoModeLookup($StereoModeID) { 2843 static $LAMEmiscStereoModeLookup = array(); 2844 if (empty($LAMEmiscStereoModeLookup)) { 2845 $LAMEmiscStereoModeLookup[0] = 'mono'; 2846 $LAMEmiscStereoModeLookup[1] = 'stereo'; 2847 $LAMEmiscStereoModeLookup[2] = 'dual'; 2848 $LAMEmiscStereoModeLookup[3] = 'joint'; 2849 $LAMEmiscStereoModeLookup[4] = 'forced'; 2850 $LAMEmiscStereoModeLookup[5] = 'auto'; 2851 $LAMEmiscStereoModeLookup[6] = 'intensity'; 2852 $LAMEmiscStereoModeLookup[7] = 'other'; 2853 } 2854 return (isset($LAMEmiscStereoModeLookup[$StereoModeID]) ? $LAMEmiscStereoModeLookup[$StereoModeID] : ''); 2855} 2856 2857function LAMEmiscSourceSampleFrequencyLookup($SourceSampleFrequencyID) { 2858 static $LAMEmiscSourceSampleFrequencyLookup = array(); 2859 if (empty($LAMEmiscSourceSampleFrequencyLookup)) { 2860 $LAMEmiscSourceSampleFrequencyLookup[0] = '<= 32 kHz'; 2861 $LAMEmiscSourceSampleFrequencyLookup[1] = '44.1 kHz'; 2862 $LAMEmiscSourceSampleFrequencyLookup[2] = '48 kHz'; 2863 $LAMEmiscSourceSampleFrequencyLookup[3] = '> 48kHz'; 2864 } 2865 return (isset($LAMEmiscSourceSampleFrequencyLookup[$SourceSampleFrequencyID]) ? $LAMEmiscSourceSampleFrequencyLookup[$SourceSampleFrequencyID] : ''); 2866} 2867 2868function LAMEsurroundInfoLookup($SurroundInfoID) { 2869 static $LAMEsurroundInfoLookup = array(); 2870 if (empty($LAMEsurroundInfoLookup)) { 2871 $LAMEsurroundInfoLookup[0] = 'no surround info'; 2872 $LAMEsurroundInfoLookup[1] = 'DPL encoding'; 2873 $LAMEsurroundInfoLookup[2] = 'DPL2 encoding'; 2874 $LAMEsurroundInfoLookup[3] = 'Ambisonic encoding'; 2875 } 2876 return (isset($LAMEsurroundInfoLookup[$SurroundInfoID]) ? $LAMEsurroundInfoLookup[$SurroundInfoID] : 'reserved'); 2877} 2878 2879for ($i = 0x00; $i <= 0xFF; $i++) { 2880 $head4 = "\xFF\xFE".chr($i)."\x00"; 2881 $isvalid = MPEGaudioHeaderBytesValid($head4); 2882 echo '<div style="color: '.($isvalid ? 'green' : 'red').';">'.str_pad(strtoupper(dechex($i)), 2, '0', STR_PAD_LEFT).' = '.htmlentities(chr($i)).' = '.($isvalid ? 'valid' : 'INVALID').'</div>'; 2883} 2884